(1R,5S,6S)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-3-((S)-tetrahydrofuran-2-carbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxamide

ID: ALA4862034

PubChem CID: 164623600

Max Phase: Preclinical

Molecular Formula: C21H26N6O3

Molecular Weight: 410.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1CCN(c2nccn3ccnc23)C1)[C@H]1[C@@H]2CN(C(=O)[C@@H]3CCCO3)C[C@@H]21

Standard InChI:  InChI=1S/C21H26N6O3/c28-20(17-14-11-27(12-15(14)17)21(29)16-2-1-9-30-16)24-13-3-6-26(10-13)19-18-22-4-7-25(18)8-5-23-19/h4-5,7-8,13-17H,1-3,6,9-12H2,(H,24,28)/t13-,14-,15+,16-,17+/m0/s1

Standard InChI Key:  CLMOVEHHTGXAGG-ZOFXXKQRSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   43.3235  -13.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1407  -13.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3950  -12.7441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7321  -12.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0733  -12.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1635  -12.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7664  -13.0428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.5411  -12.7943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7163  -11.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1104  -11.4460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3293  -11.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1122  -10.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3406  -10.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8622  -11.0374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.2960  -12.4919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.6890  -13.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9117  -12.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8593  -13.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1131  -12.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3659  -12.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7036  -11.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0414  -12.1826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2945  -12.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9421  -11.5975    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.3230  -13.7478    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.2641  -11.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0941  -11.1310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6570  -12.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8576  -12.3081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4492  -13.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9961  -13.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7425  -13.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 28 26  1  6
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4862034

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.48Molecular Weight (Monoisotopic): 410.2066AlogP: 0.31#Rotatable Bonds: 4
Polar Surface Area: 92.07Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -1.25CX LogD: -1.25
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.78Np Likeness Score: -1.19

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source