(1R,5S,6r)-N6-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-N3,N3-dimethyl-3-azabicyclo[3.1.0]hexane-3,6-dicarboxamide

ID: ALA4862073

PubChem CID: 164625412

Max Phase: Preclinical

Molecular Formula: C19H25N7O2

Molecular Weight: 383.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)N1C[C@@H]2[C@H](C1)[C@H]2C(=O)N[C@H]1CCN(c2nccn3ccnc23)C1

Standard InChI:  InChI=1S/C19H25N7O2/c1-23(2)19(28)26-10-13-14(11-26)15(13)18(27)22-12-3-6-25(9-12)17-16-20-4-7-24(16)8-5-21-17/h4-5,7-8,12-15H,3,6,9-11H2,1-2H3,(H,22,27)/t12-,13-,14+,15+/m0/s1

Standard InChI Key:  YVKWOGKMJMDEEE-BYNSBNAKSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    6.5004  -26.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3175  -26.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5719  -26.0833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9089  -25.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2502  -26.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3403  -25.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9432  -26.3820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7180  -26.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8932  -25.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2873  -24.7852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5061  -25.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2890  -23.9734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5175  -23.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0391  -24.3766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4729  -25.8311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8659  -26.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0885  -26.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0361  -27.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2900  -26.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5428  -25.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8805  -25.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2182  -25.5218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4714  -26.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1190  -24.9367    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4999  -27.0870    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4410  -25.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2709  -24.4702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8338  -25.8164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0345  -25.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9194  -26.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 30 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4862073

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.46Molecular Weight (Monoisotopic): 383.2070AlogP: 0.28#Rotatable Bonds: 3
Polar Surface Area: 86.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -1.58CX LogD: -1.58
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: -1.40

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source