(1R,5S,6S)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)-3-((S)-2-methylpyrrolidine-1-carbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxamide

ID: ALA4862143

PubChem CID: 164620430

Max Phase: Preclinical

Molecular Formula: C22H29N7O2

Molecular Weight: 423.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1CCCN1C(=O)N1C[C@@H]2[C@H](C1)[C@H]2C(=O)N[C@H]1CCN(c2nccn3ccnc23)C1

Standard InChI:  InChI=1S/C22H29N7O2/c1-14-3-2-7-29(14)22(31)28-12-16-17(13-28)18(16)21(30)25-15-4-8-27(11-15)20-19-23-5-9-26(19)10-6-24-20/h5-6,9-10,14-18H,2-4,7-8,11-13H2,1H3,(H,25,30)/t14-,15-,16-,17+,18+/m0/s1

Standard InChI Key:  PTASFCFUSDLTGY-NNPSNHGLSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   18.5642  -19.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3814  -19.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6358  -18.6337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9728  -18.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3141  -18.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4042  -18.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0071  -18.9323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7819  -18.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9571  -17.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3512  -17.3356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5700  -17.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3529  -16.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5814  -16.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1029  -16.9270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5368  -18.3815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9297  -18.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1524  -18.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1000  -19.7278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3539  -18.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6067  -18.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9444  -17.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2821  -18.0722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5353  -18.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1829  -17.4871    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.5638  -19.6374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5049  -17.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3348  -17.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8977  -18.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0984  -18.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6899  -18.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2369  -19.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9833  -19.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6911  -19.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  1
 16 18  2  0
 20 17  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 20 24  1  1
 19 25  1  1
 22 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 32 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4862143

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.2383AlogP: 1.21#Rotatable Bonds: 3
Polar Surface Area: 86.08Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: -0.76CX LogD: -0.76
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.80Np Likeness Score: -1.23

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source