The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1,9-dihydroxy-2,10-dimethoxy-6a,7-dihydro-4H-dibenzo[de,g]quinolin-6(5H)-yl)(4-nitrophenyl)methanone ID: ALA4862309
PubChem CID: 164624426
Max Phase: Preclinical
Molecular Formula: C25H22N2O7
Molecular Weight: 462.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1O)CC1c3c(cc(OC)c(O)c3-2)CCN1C(=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C25H22N2O7/c1-33-20-12-17-15(10-19(20)28)9-18-22-14(11-21(34-2)24(29)23(17)22)7-8-26(18)25(30)13-3-5-16(6-4-13)27(31)32/h3-6,10-12,18,28-29H,7-9H2,1-2H3
Standard InChI Key: GGXFLMKMDUVNQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
17.1348 -13.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1337 -14.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8399 -13.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5486 -13.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9655 -14.6865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9666 -13.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2559 -13.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5474 -14.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8422 -15.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2496 -15.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2520 -15.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5444 -16.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8459 -15.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1446 -16.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1406 -17.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8437 -17.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5421 -17.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4268 -15.0970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4270 -13.4590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4268 -12.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8429 -18.3343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4316 -17.5164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7252 -17.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6705 -15.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6653 -15.9168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3809 -14.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0822 -15.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7920 -14.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7978 -13.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0877 -13.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3808 -13.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5097 -13.4823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5139 -12.6651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2153 -13.8945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 9 1 0
4 3 2 0
3 1 1 0
4 8 1 0
4 7 1 0
11 5 1 0
5 6 1 0
6 7 1 0
8 9 2 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 18 1 0
1 19 1 0
19 20 1 0
16 21 1 0
15 22 1 0
22 23 1 0
5 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 2 0
32 34 1 0
29 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.46Molecular Weight (Monoisotopic): 462.1427AlogP: 3.99#Rotatable Bonds: 4Polar Surface Area: 122.37Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 3.80CX LogD: 3.79Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: 0.39
References 1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y.. (2021) Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells., 37 [PMID:33556569 ] [10.1016/j.bmcl.2021.127844 ]