The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(2,4,6-trichlorophenyl)acetamide ID: ALA4862684
PubChem CID: 164624448
Max Phase: Preclinical
Molecular Formula: C22H13Cl3I2N4O4S2
Molecular Weight: 821.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3c(Cl)cc(Cl)cc3Cl)nc3c(I)cc(I)cc3c2=O)cc1
Standard InChI: InChI=1S/C22H13Cl3I2N4O4S2/c23-10-5-15(24)20(16(25)6-10)29-18(32)9-36-22-30-19-14(7-11(26)8-17(19)27)21(33)31(22)12-1-3-13(4-2-12)37(28,34)35/h1-8H,9H2,(H,29,32)(H2,28,34,35)
Standard InChI Key: IGEZYKMFZKOKEE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
32.3905 -0.9493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8032 -1.6591 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.2116 -0.9468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1310 -3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1298 -4.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8379 -4.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8361 -2.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5447 -3.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5435 -4.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2536 -4.5182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9695 -4.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9706 -3.2837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2560 -2.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4232 -2.8768 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
27.8376 -5.3309 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
29.2560 -2.0506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6776 -2.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3846 -3.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0929 -2.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0953 -2.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3836 -1.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6783 -2.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6760 -4.5195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.5107 -2.0688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3849 -4.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0914 -4.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8003 -4.1169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0891 -5.3406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5068 -4.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4998 -5.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2055 -5.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9154 -5.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9150 -4.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2087 -4.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2062 -3.3001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.7897 -5.7461 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
35.6225 -5.7552 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
4 14 1 0
6 15 1 0
13 16 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
12 17 1 0
11 23 1 0
20 2 1 0
2 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
34 35 1 0
30 36 1 0
32 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 821.67Molecular Weight (Monoisotopic): 819.7533AlogP: 5.93#Rotatable Bonds: 6Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.10CX Basic pKa: ┄CX LogP: 6.91CX LogD: 6.91Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.14Np Likeness Score: -2.09
References 1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM.. (2021) Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress., 42 [PMID:33811990 ] [10.1016/j.bmcl.2021.128002 ]