The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,5-dihydroxy-N-(6-(hydroxyamino)-6-oxohexyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide ID: ALA4862917
PubChem CID: 164624453
Max Phase: Preclinical
Molecular Formula: C21H20N2O7
Molecular Weight: 412.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCNC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O)NO
Standard InChI: InChI=1S/C21H20N2O7/c24-14-6-4-5-12-17(14)20(28)18-13(19(12)27)9-11(10-15(18)25)21(29)22-8-3-1-2-7-16(26)23-30/h4-6,9-10,24-25,30H,1-3,7-8H2,(H,22,29)(H,23,26)
Standard InChI Key: BWMRGOQFHBXKQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
11.8094 -10.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8094 -8.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5226 -8.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5210 -9.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2330 -10.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9472 -9.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9448 -8.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2321 -8.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0963 -9.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0989 -8.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3874 -8.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6727 -8.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6741 -9.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3864 -10.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3890 -7.6475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8080 -7.6411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2301 -7.6474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8106 -10.9461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6631 -10.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6639 -10.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3784 -9.7080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0943 -10.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8095 -9.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5254 -10.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2406 -9.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9566 -10.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6717 -9.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3878 -10.1160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1029 -9.7022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6709 -8.8774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
11 15 1 0
2 16 2 0
8 17 1 0
1 18 2 0
6 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.40Molecular Weight (Monoisotopic): 412.1271AlogP: 1.67#Rotatable Bonds: 7Polar Surface Area: 153.03Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.43CX Basic pKa: ┄CX LogP: 2.77CX LogD: 2.45Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.22Np Likeness Score: 0.37
References 1. Peng X, Sun Z, Kuang P, Chen J.. (2020) Recent progress on HDAC inhibitors with dual targeting capabilities for cancer treatment., 208 [PMID:32961382 ] [10.1016/j.ejmech.2020.112831 ]