4,5-dihydroxy-N-(6-(hydroxyamino)-6-oxohexyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide

ID: ALA4862917

PubChem CID: 164624453

Max Phase: Preclinical

Molecular Formula: C21H20N2O7

Molecular Weight: 412.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCCNC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O)NO

Standard InChI:  InChI=1S/C21H20N2O7/c24-14-6-4-5-12-17(14)20(28)18-13(19(12)27)9-11(10-15(18)25)21(29)22-8-3-1-2-7-16(26)23-30/h4-6,9-10,24-25,30H,1-3,7-8H2,(H,22,29)(H,23,26)

Standard InChI Key:  BWMRGOQFHBXKQR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   11.8094  -10.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8094   -8.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5226   -8.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5210   -9.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2330  -10.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9472   -9.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9448   -8.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2321   -8.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0963   -9.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0989   -8.8865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3874   -8.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6727   -8.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6741   -9.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3864  -10.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3890   -7.6475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8080   -7.6411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2301   -7.6474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8106  -10.9461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6631  -10.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6639  -10.9481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3784   -9.7080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0943  -10.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8095   -9.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5254  -10.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2406   -9.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9566  -10.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6717   -9.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3878  -10.1160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1029   -9.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6709   -8.8774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 11 15  1  0
  2 16  2  0
  8 17  1  0
  1 18  2  0
  6 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4862917

    ---

Associated Targets(Human)

T98G (1524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U-87 MG (3946 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U-251 (51189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.40Molecular Weight (Monoisotopic): 412.1271AlogP: 1.67#Rotatable Bonds: 7
Polar Surface Area: 153.03Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 7.43CX Basic pKa: CX LogP: 2.77CX LogD: 2.45
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.22Np Likeness Score: 0.37

References

1. Peng X, Sun Z, Kuang P, Chen J..  (2020)  Recent progress on HDAC inhibitors with dual targeting capabilities for cancer treatment.,  208  [PMID:32961382] [10.1016/j.ejmech.2020.112831]

Source