(2E)-3-(Benzo[d][1,3]dioxol-6-yl)-1-(5-hydroxy-7-methoxy-2,2-dimethyl-2H-chromen-6-yl)prop-2-en-1-one

ID: ALA4862947

PubChem CID: 15719487

Max Phase: Preclinical

Molecular Formula: C22H20O6

Molecular Weight: 380.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(c(O)c1C(=O)/C=C/c1ccc3c(c1)OCO3)C=CC(C)(C)O2

Standard InChI:  InChI=1S/C22H20O6/c1-22(2)9-8-14-17(28-22)11-19(25-3)20(21(14)24)15(23)6-4-13-5-7-16-18(10-13)27-12-26-16/h4-11,24H,12H2,1-3H3/b6-4+

Standard InChI Key:  RJYLDTKZVYKSBL-GQCTYLIASA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   17.1261  -27.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8332  -28.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8256  -26.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1219  -27.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3156  -26.9027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3458  -25.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1629  -25.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7579  -25.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8744  -27.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5824  -28.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8755  -27.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5798  -26.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5760  -25.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8696  -25.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1675  -26.7655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0017  -29.2091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5822  -29.2111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2893  -27.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2926  -27.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0011  -28.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7107  -27.9766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9943  -26.7463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4190  -28.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8744  -29.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3181  -28.2255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5389  -27.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5399  -27.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7979  -27.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2 27  1  0
 26  3  1  0
  3  4  2  0
  4  1  1  0
 26  5  1  0
  7  6  1  0
  8  7  1  0
 11  9  2  0
  9 10  1  0
 10 19  2  0
 18 12  2  0
 11 12  1  0
 11 15  1  0
 12 13  1  0
 13 14  2  0
 14  7  1  0
  7 15  1  0
 20 16  2  0
 10 17  1  0
 18 19  1  0
 18 22  1  0
 19 20  1  0
 20 21  1  0
 21 23  2  0
 23  1  1  0
 17 24  1  0
 27 25  1  0
 26 27  2  0
 25 28  1  0
 28  5  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

MEF (1005 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 380.40Molecular Weight (Monoisotopic): 380.1260AlogP: 4.21#Rotatable Bonds: 4
Polar Surface Area: 74.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.09CX Basic pKa: CX LogP: 4.60CX LogD: 4.12
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: 1.75

References

1. Urmann C, Bieler L, Priglinger E, Aigner L, Couillard-Despres S, Riepl HM..  (2021)  Neuroregenerative Potential of Prenyl- and Pyranochalcones: A Structure-Activity Study.,  84  (10.0): [PMID:34542287] [10.1021/acs.jnatprod.1c00505]

Source