The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5-(6-chlorobenzo[d][1,3]dioxol-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl)-1-phenylmethanesulfonamide ID: ALA4863128
PubChem CID: 146302409
Max Phase: Preclinical
Molecular Formula: C28H19ClFN3O5S
Molecular Weight: 563.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cccc(NS(=O)(=O)Cc2ccccc2)c1F)c1c[nH]c2ncc(-c3cc4c(cc3Cl)OCO4)cc12
Standard InChI: InChI=1S/C28H19ClFN3O5S/c29-22-11-25-24(37-15-38-25)10-19(22)17-9-20-21(13-32-28(20)31-12-17)27(34)18-7-4-8-23(26(18)30)33-39(35,36)14-16-5-2-1-3-6-16/h1-13,33H,14-15H2,(H,31,32)
Standard InChI Key: NLOICNFFUMVDFD-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
10.1663 -3.0832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1706 -3.9082 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8829 -3.4921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1859 -4.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1848 -5.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8995 -5.5067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8978 -3.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6132 -4.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6180 -5.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4054 -5.3401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8874 -4.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3977 -4.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4714 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4747 -3.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7628 -4.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6479 -3.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4538 -3.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0924 -2.6071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0060 -3.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8112 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0623 -2.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5018 -2.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6987 -2.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3666 -4.0850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7279 -4.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7603 -2.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7543 -4.4364 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4761 -5.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0484 -3.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0472 -3.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2622 -2.7791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7782 -3.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2642 -4.1140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1907 -2.6187 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.6699 -5.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4183 -6.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9729 -6.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7791 -6.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0307 -5.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
13 14 2 0
14 26 1 0
29 15 2 0
15 13 1 0
12 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
20 24 1 0
24 2 1 0
2 25 1 0
30 26 2 0
19 27 1 0
25 28 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
14 34 1 0
28 35 1 0
28 39 2 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.99Molecular Weight (Monoisotopic): 563.0718AlogP: 5.92#Rotatable Bonds: 7Polar Surface Area: 110.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.57CX Basic pKa: 1.41CX LogP: 4.95CX LogD: 4.92Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.01
References 1. Klövekorn P, Pfaffenrot B, Juchum M, Selig R, Albrecht W, Zender L, Laufer SA.. (2021) From off-to on-target: New BRAF-inhibitor-template-derived compounds selectively targeting mitogen activated protein kinase kinase 4 (MKK4)., 210 [PMID:33199152 ] [10.1016/j.ejmech.2020.112963 ]