Ethyl 6-((2,7-diazaspiro[4.4]nonan-2-yl)methyl)-4-(2-bromo-4-fluorophenyl)-2-(thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate

ID: ALA4863182

PubChem CID: 164618736

Max Phase: Preclinical

Molecular Formula: C24H27BrFN5O2S

Molecular Weight: 548.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(CN2CCC3(CCNC3)C2)NC(c2nccs2)=NC1c1ccc(F)cc1Br

Standard InChI:  InChI=1S/C24H27BrFN5O2S/c1-2-33-23(32)19-18(12-31-9-6-24(14-31)5-7-27-13-24)29-21(22-28-8-10-34-22)30-20(19)16-4-3-15(26)11-17(16)25/h3-4,8,10-11,20,27H,2,5-7,9,12-14H2,1H3,(H,29,30)

Standard InChI Key:  QRKZMGNAJNAOHJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   12.7973   -7.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5827   -8.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2661   -8.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032   -8.4384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6133   -7.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1025   -4.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1014   -5.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8094   -5.6363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5191   -5.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5163   -4.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8076   -3.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3947   -3.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3945   -3.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6871   -4.4082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9793   -3.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2717   -4.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3934   -5.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3927   -6.4526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8024   -3.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5105   -2.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5084   -1.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7990   -1.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0901   -1.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0957   -2.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2280   -5.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3147   -6.4445    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.1143   -6.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5218   -5.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9740   -5.2985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2190   -3.1817    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   13.7954   -0.7336    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.7312   -6.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9831   -7.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0533   -6.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  6  1  0
  6 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
  7 17  1  0
 17 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 11 19  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  2  0
  9 25  1  0
 20 30  1  0
 22 31  1  0
 18 32  1  0
 32 33  1  0
 33  1  1  0
  1 34  1  0
 34 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4863182

    ---

Associated Targets(non-human)

HBcAg Core antigen (581 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.48Molecular Weight (Monoisotopic): 547.1053AlogP: 3.64#Rotatable Bonds: 6
Polar Surface Area: 78.85Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.93CX LogP: 2.88CX LogD: -0.18
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.23

References

1. Ma Y, Zhao S, Ren Y, Cherukupalli S, Li Q, Woodson ME, Bradley DP, Tavis JE, Liu X, Zhan P..  (2021)  Design, synthesis and evaluation of heteroaryldihydropyrimidine analogues bearing spiro ring as hepatitis B virus capsid protein inhibitors.,  225  [PMID:34438123] [10.1016/j.ejmech.2021.113780]

Source