6-(1H-indol-3-yl)-1-(2-(piperazin-1-yl)ethyl)-1H-benzo[d][1,2,3]triazole

ID: ALA4863211

PubChem CID: 164619533

Max Phase: Preclinical

Molecular Formula: C20H22N6

Molecular Weight: 346.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc2c(-c3ccc4c(c3)nnn4CCN3CCNCC3)c[nH]c2c1

Standard InChI:  InChI=1S/C20H22N6/c1-2-4-18-16(3-1)17(14-22-18)15-5-6-20-19(13-15)23-24-26(20)12-11-25-9-7-21-8-10-25/h1-6,13-14,21-22H,7-12H2

Standard InChI Key:  SYUKRGUWSXQFQM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   29.4298   -8.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4287   -8.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1367   -9.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1350   -7.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8436   -8.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8484   -8.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6284   -9.1033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1058   -8.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6207   -7.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8686   -7.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6688   -6.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5643   -5.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3200   -6.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3687   -5.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9139   -6.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6584   -5.7188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5734   -4.9083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7764   -4.7388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4441   -3.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9246   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5923   -2.5845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0803   -1.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7513   -1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9387   -1.0896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4561   -1.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7861   -2.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4863211

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.44Molecular Weight (Monoisotopic): 346.1906AlogP: 2.48#Rotatable Bonds: 4
Polar Surface Area: 61.77Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.23CX LogP: 2.65CX LogD: 0.83
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: -1.37

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source