2-(((2S,3S)-3-((3,5-dichlorobenzyl)oxy)-2-phenylpiperidin-1-yl)methyl)oxazole

ID: ALA4863314

PubChem CID: 164621665

Max Phase: Preclinical

Molecular Formula: C22H22Cl2N2O2

Molecular Weight: 417.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Clc1cc(Cl)cc(CO[C@H]2CCCN(Cc3ncco3)[C@H]2c2ccccc2)c1

Standard InChI:  InChI=1S/C22H22Cl2N2O2/c23-18-11-16(12-19(24)13-18)15-28-20-7-4-9-26(14-21-25-8-10-27-21)22(20)17-5-2-1-3-6-17/h1-3,5-6,8,10-13,20,22H,4,7,9,14-15H2/t20-,22-/m0/s1

Standard InChI Key:  XNGPCFOJZBYFSU-UNMCSNQZSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   23.5871  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5871  -16.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2924  -16.4264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9977  -16.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9977  -15.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2924  -14.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7066  -14.7982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7048  -16.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7004  -17.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4067  -17.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1160  -17.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1146  -16.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4077  -16.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7090  -13.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4179  -13.5745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1242  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8326  -13.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8354  -12.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1239  -12.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4184  -12.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1234  -11.5360    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.5389  -13.9928    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.2924  -17.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5847  -17.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8339  -17.3229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2871  -17.9302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6957  -18.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4950  -18.4679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  6
  4  8  1  6
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 17 22  1  0
  3 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4863314

    ---

Associated Targets(Human)

PRKG1 Tchem cGMP-dependent protein kinase 1 beta (2814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.34Molecular Weight (Monoisotopic): 416.1058AlogP: 5.90#Rotatable Bonds: 6
Polar Surface Area: 38.50Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.62CX LogP: 5.07CX LogD: 5.00
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -0.66

References

1. Hanisak J, Soriano A, Adam GC, Basso A, Bauman D, Bell D, Frank E, O'Donnell G, Tawa P, Verras A, Yu Y, Zhang L, Seganish WM..  (2021)  Discovery of the First Non-cGMP Mimetic Small Molecule Activators of cGMP-Dependent Protein Kinase 1 α (PKG1α).,  12  (8.0): [PMID:34413956] [10.1021/acsmedchemlett.1c00264]

Source