The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1S,4S)-4-(5-methyl-2-((3-methyl-4-(4-methylpiperazin-1-yl)phenyl)amino)-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cyclohexyl)propionamide ID: ALA4863607
PubChem CID: 164624899
Max Phase: Preclinical
Molecular Formula: C29H39N7O2
Molecular Weight: 517.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N[C@H]1CC[C@@H](n2c(=O)cc(C)c3cnc(Nc4ccc(N5CCN(C)CC5)c(C)c4)nc32)CC1
Standard InChI: InChI=1S/C29H39N7O2/c1-5-26(37)31-21-6-9-23(10-7-21)36-27(38)17-19(2)24-18-30-29(33-28(24)36)32-22-8-11-25(20(3)16-22)35-14-12-34(4)13-15-35/h8,11,16-18,21,23H,5-7,9-10,12-15H2,1-4H3,(H,31,37)(H,30,32,33)/t21-,23+
Standard InChI Key: PSTOSUNGTQJNJH-DKXQDJALSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
23.4141 -15.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1189 -15.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1064 -14.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4265 -16.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7009 -15.5147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6926 -14.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9794 -14.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9669 -13.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6717 -13.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3808 -13.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3932 -14.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5322 -11.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2454 -12.2669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9461 -11.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9336 -11.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2205 -10.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5198 -11.0515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6385 -10.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3516 -11.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3641 -11.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6593 -12.2464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0731 -12.2301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8274 -12.2833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1143 -11.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4136 -12.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7004 -11.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6879 -11.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3928 -10.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1059 -11.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9748 -10.6901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2741 -11.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5609 -10.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5484 -9.8894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2533 -9.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9664 -9.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8353 -9.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9997 -12.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6260 -9.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
18 19 2 0
19 20 1 0
20 21 1 0
14 21 1 0
15 18 1 0
20 22 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
30 35 1 0
33 36 1 0
27 30 1 0
26 37 1 0
23 24 1 0
12 23 1 0
18 38 1 0
9 21 1 1
6 5 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.68Molecular Weight (Monoisotopic): 517.3165AlogP: 3.91#Rotatable Bonds: 6Polar Surface Area: 95.39Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.86CX LogP: 3.84CX LogD: 3.25Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: -1.46
References 1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K.. (2021) Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors., 211 [PMID:33248853 ] [10.1016/j.ejmech.2020.113023 ]