(4S,5S,E)-5-(benzo[d][1,3]dioxol-5-yl)-4,5-dihydroxy-1-(piperidin-1-yl)pent-2-en-1-one

ID: ALA4863717

PubChem CID: 164621688

Max Phase: Preclinical

Molecular Formula: C17H21NO5

Molecular Weight: 319.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/[C@H](O)[C@@H](O)c1ccc2c(c1)OCO2)N1CCCCC1

Standard InChI:  InChI=1S/C17H21NO5/c19-13(5-7-16(20)18-8-2-1-3-9-18)17(21)12-4-6-14-15(10-12)23-11-22-14/h4-7,10,13,17,19,21H,1-3,8-9,11H2/b7-5+/t13-,17-/m0/s1

Standard InChI Key:  OYFCOFKWCRBXAB-FSJMSVOZSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   10.1241   -8.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1241   -9.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8294   -9.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5347   -9.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5347   -8.6507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8294   -8.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2436   -8.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9501   -8.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6590   -8.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2459   -7.4270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3655   -8.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0744   -8.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7809   -8.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7732   -9.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4789   -9.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4823   -8.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1886   -8.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1853   -9.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9623   -9.7379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4458   -9.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9676   -8.4143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3631   -9.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0768   -7.4353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  7 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 11 22  1  1
 12 23  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4863717

    ---

Associated Targets(non-human)

Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.36Molecular Weight (Monoisotopic): 319.1420AlogP: 1.38#Rotatable Bonds: 4
Polar Surface Area: 79.23Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.19CX Basic pKa: CX LogP: 0.91CX LogD: 0.91
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.82Np Likeness Score: 0.50

References

1. Luo J, Xiang JY, Yuan HY, Wu JQ, Li HZ, Shen YH, Xu M..  (2021)  Isolation, synthesis and absolute configuration of 4,5-dihydroxypiperines improving behavioral disorder in AlCl3-induced dementia.,  42  [PMID:33892105] [10.1016/j.bmcl.2021.128057]

Source