6-(5-Bromothiophen-2-yl)-4-(4-(2-hydroxyphenyl)piperazin-1-yl)-2-oxo-2H-pyran-3-carbonitrile

ID: ALA4863721

PubChem CID: 164622167

Max Phase: Preclinical

Molecular Formula: C20H16BrN3O3S

Molecular Weight: 458.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1c(N2CCN(c3ccccc3O)CC2)cc(-c2ccc(Br)s2)oc1=O

Standard InChI:  InChI=1S/C20H16BrN3O3S/c21-19-6-5-18(28-19)17-11-15(13(12-22)20(26)27-17)24-9-7-23(8-10-24)14-3-1-2-4-16(14)25/h1-6,11,25H,7-10H2

Standard InChI Key:  NECOWWJCCRGHSV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   21.6821  -16.2369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3941  -15.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3941  -15.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6821  -14.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9701  -15.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9655  -14.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6852  -13.7620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1097  -14.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8254  -14.1829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1079  -16.2422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4084  -13.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4135  -12.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7025  -12.1133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9846  -12.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9778  -13.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7087  -11.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4280  -10.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4346  -10.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7227   -9.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0028  -10.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9997  -10.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1382  -11.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2574  -16.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5050  -15.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9556  -16.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3712  -17.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1773  -17.0697    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.0388  -17.9997    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  5  6  2  0
  4  7  1  0
  3  8  1  0
  8  9  3  0
  2 10  2  0
  7 11  1  0
  7 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
  5 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4863721

    ---

Associated Targets(non-human)

Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.34Molecular Weight (Monoisotopic): 457.0096AlogP: 4.03#Rotatable Bonds: 3
Polar Surface Area: 80.71Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.20CX Basic pKa: 2.35CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.64Np Likeness Score: -0.98

References

1. Mishra S, Parmar N, Chandrakar P, Sharma CP, Parveen S, Vats RP, Seth A, Goel A, Kar S..  (2021)  Design, synthesis, in vitro and in vivo biological evaluation of pyranone-piperazine analogs as potent antileishmanial agents.,  221  [PMID:33992928] [10.1016/j.ejmech.2021.113516]

Source