5-Chloro-N-[4-(1-propyl-7,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yloxy)-phenyl]-2-methoxybenzenesulfonamide

ID: ALA4863725

PubChem CID: 164622172

Max Phase: Preclinical

Molecular Formula: C27H26ClN5O4S

Molecular Weight: 552.06

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1nnc2c(Oc3ccc(NS(=O)(=O)c4cc(Cl)ccc4OC)cc3)nc3cc(C)c(C)cc3n12

Standard InChI:  InChI=1S/C27H26ClN5O4S/c1-5-6-25-30-31-26-27(29-21-13-16(2)17(3)14-22(21)33(25)26)37-20-10-8-19(9-11-20)32-38(34,35)24-15-18(28)7-12-23(24)36-4/h7-15,32H,5-6H2,1-4H3

Standard InChI Key:  QALCGQUMECIAMX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   10.4006  -14.4948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8133  -15.2047    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.2218  -14.4923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5368  -15.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2319  -15.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9523  -15.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9720  -16.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2770  -16.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5600  -16.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1145  -15.6132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2065  -14.3455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9037  -13.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4026  -15.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6963  -15.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9886  -15.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9829  -14.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6892  -13.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4011  -14.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2752  -13.9941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8683  -15.6341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5745  -15.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5689  -14.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8570  -13.9997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1549  -14.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4430  -14.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7367  -14.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7423  -15.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4501  -15.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1564  -15.2262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8513  -16.5138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1847  -15.7643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0404  -16.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0361  -15.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0290  -14.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3002  -17.6127    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4955  -17.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7505  -17.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2057  -18.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
  5 11  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 20 29  1  0
 24 29  2  0
 30 31  1  0
 30 32  2  0
 20 32  1  0
 21 31  2  0
 19 22  1  0
 27 33  1  0
 26 34  1  0
 16 19  1  0
 10 13  1  0
  8 35  1  0
 32 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4863725

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 552.06Molecular Weight (Monoisotopic): 551.1394AlogP: 6.10#Rotatable Bonds: 8
Polar Surface Area: 107.71Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.04CX Basic pKa: 1.93CX LogP: 5.31CX LogD: 4.89
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.77

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source