The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-(2,2,2-trifluoroethyl)-N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamothioate ID: ALA4863822
PubChem CID: 164618748
Max Phase: Preclinical
Molecular Formula: C23H25F3N2O5S
Molecular Weight: 498.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=S)OCC(F)(F)F)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C23H25F3N2O5S/c1-27-16-8-6-13-14(10-17(16)29)15(28-22(34)33-11-23(24,25)26)7-5-12-9-18(30-2)20(31-3)21(32-4)19(12)13/h6,8-10,15H,5,7,11H2,1-4H3,(H,27,29)(H,28,34)/t15-/m0/s1
Standard InChI Key: RUSWNRCVEJTRDQ-HNNXBMFYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
39.5794 -2.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5783 -3.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2870 -3.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2852 -2.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9979 -3.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9986 -2.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6450 -2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4516 -2.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8071 -2.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6449 -3.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4539 -3.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1076 -4.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2818 -4.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1128 -5.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6478 -5.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4624 -5.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6472 -6.4004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0453 -6.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8509 -5.4411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6258 -2.9862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2879 -4.6360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8696 -3.8164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8710 -2.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8708 -1.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1614 -3.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5799 -5.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0356 -2.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8584 -2.2709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6226 -1.5611 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.2713 -2.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0941 -2.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5071 -3.6924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.5039 -2.2673 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.9152 -2.9794 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
3 21 1 0
2 22 1 0
1 23 1 0
23 24 1 0
22 25 1 0
21 26 1 0
20 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.52Molecular Weight (Monoisotopic): 498.1436AlogP: 4.22#Rotatable Bonds: 6Polar Surface Area: 78.05Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.45CX Basic pKa: 3.80CX LogP: 3.61CX LogD: 3.58Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.57Np Likeness Score: 0.14
References 1. Krzywik J, Aminpour M, Janczak J, Maj E, Moshari M, Mozga W, Wietrzyk J, Tuszyński JA, Huczyński A.. (2021) An insight into the anticancer potential of carbamates and thiocarbamates of 10-demethoxy-10-methylaminocolchicine., 215 [PMID:33611191 ] [10.1016/j.ejmech.2021.113282 ]