The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,15aS)-N-((S)-1-((R)-2-Methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl)-1,11-dioxotetradecahydropyrrolo[2,1-f][1]oxa[4,7]-diazacyclotridecine-3-carboxamide ID: ALA4864020
PubChem CID: 164620009
Max Phase: Preclinical
Molecular Formula: C26H35N3O6
Molecular Weight: 485.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]1(C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2COCCCCCC(=O)N3CCC[C@H]3C(=O)N2)CO1
Standard InChI: InChI=1S/C26H35N3O6/c1-26(17-35-26)23(31)19(15-18-9-4-2-5-10-18)27-24(32)20-16-34-14-7-3-6-12-22(30)29-13-8-11-21(29)25(33)28-20/h2,4-5,9-10,19-21H,3,6-8,11-17H2,1H3,(H,27,32)(H,28,33)/t19-,20-,21-,26+/m0/s1
Standard InChI Key: NMXIXHHDFTVBOM-HJJDGDTKSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
7.8604 -15.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2781 -15.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6894 -15.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2638 -16.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8688 -16.8708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5858 -16.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4273 -15.6552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6095 -15.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3370 -16.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4117 -17.6335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0108 -16.3315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7567 -16.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4332 -16.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1830 -16.5513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3626 -15.3850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8355 -17.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8560 -16.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6032 -16.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6779 -17.2413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7813 -15.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4228 -14.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0270 -16.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 -15.7556 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7749 -17.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0342 -17.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4219 -18.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6291 -18.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4073 -19.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9777 -18.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7558 -18.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3262 -18.1960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2888 -14.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9299 -14.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7037 -13.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8303 -13.1241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1929 -13.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
1 3 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
6 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
12 16 1 6
14 17 1 0
17 18 1 0
18 19 2 0
17 20 1 1
20 21 1 0
18 2 1 0
2 22 1 6
6 23 1 6
5 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
16 31 1 0
21 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2526AlogP: 1.14#Rotatable Bonds: 6Polar Surface Area: 117.34Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.93CX Basic pKa: ┄CX LogP: 1.44CX LogD: 1.44Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.58Np Likeness Score: 0.29
References 1. Lee MJ, Bhattarai D, Jang H, Baek A, Yeo IJ, Lee S, Miller Z, Lee S, Hong JT, Kim DE, Lee W, Kim KB.. (2021) Macrocyclic Immunoproteasome Inhibitors as a Potential Therapy for Alzheimer's Disease., 64 (15.0): [PMID:34309393 ] [10.1021/acs.jmedchem.1c00291 ]