The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5-(2-chloro-4-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl)-1-phenylmethanesulfonamide ID: ALA4864124
PubChem CID: 156635822
Max Phase: Preclinical
Molecular Formula: C28H21ClFN3O4S
Molecular Weight: 550.01
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cnc3[nH]cc(C(=O)c4cccc(NS(=O)(=O)Cc5ccccc5)c4F)c3c2)c(Cl)c1
Standard InChI: InChI=1S/C28H21ClFN3O4S/c1-37-19-10-11-20(24(29)13-19)18-12-22-23(15-32-28(22)31-14-18)27(34)21-8-5-9-25(26(21)30)33-38(35,36)16-17-6-3-2-4-7-17/h2-15,33H,16H2,1H3,(H,31,32)
Standard InChI Key: LQELWGSNUSSUPG-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
33.8030 -26.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8071 -27.7407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.5196 -27.3246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8226 -28.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8215 -28.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5362 -29.3392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5344 -27.6862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2498 -28.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2546 -28.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0421 -29.1726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5240 -28.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0343 -27.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1081 -27.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1113 -26.8607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6851 -27.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3994 -28.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2846 -27.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0905 -26.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7290 -26.4396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6427 -27.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4479 -27.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6990 -26.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1385 -25.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3353 -26.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0033 -27.9175 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3646 -28.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6809 -26.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3971 -26.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3909 -28.2688 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.1128 -29.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9633 -26.4600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9572 -25.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8274 -26.4512 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.3066 -29.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0549 -30.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6095 -30.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4158 -30.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6674 -29.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
13 14 2 0
14 28 1 0
27 15 1 0
15 16 2 0
16 13 1 0
12 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 18 1 0
21 25 1 0
25 2 1 0
2 26 1 0
27 28 2 0
20 29 1 0
26 30 1 0
27 31 1 0
31 32 1 0
14 33 1 0
30 34 1 0
30 38 2 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.01Molecular Weight (Monoisotopic): 549.0925AlogP: 6.20#Rotatable Bonds: 8Polar Surface Area: 101.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.57CX Basic pKa: 1.43CX LogP: 5.17CX LogD: 5.14Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -1.20
References 1. Klövekorn P, Pfaffenrot B, Juchum M, Selig R, Albrecht W, Zender L, Laufer SA.. (2021) From off-to on-target: New BRAF-inhibitor-template-derived compounds selectively targeting mitogen activated protein kinase kinase 4 (MKK4)., 210 [PMID:33199152 ] [10.1016/j.ejmech.2020.112963 ]