2,6-difluoro-4-(7-(4-(4-methylpiperazin-1-yl)phenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-ylamino)phenol

ID: ALA4864190

PubChem CID: 164619595

Max Phase: Preclinical

Molecular Formula: C23H22F2N6O

Molecular Weight: 436.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(-n3ccc4cnc(Nc5cc(F)c(O)c(F)c5)nc43)cc2)CC1

Standard InChI:  InChI=1S/C23H22F2N6O/c1-29-8-10-30(11-9-29)17-2-4-18(5-3-17)31-7-6-15-14-26-23(28-22(15)31)27-16-12-19(24)21(32)20(25)13-16/h2-7,12-14,32H,8-11H2,1H3,(H,26,27,28)

Standard InChI Key:  HFYKPLLUZVWVOL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   19.7026   -3.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7014   -4.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4161   -5.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1323   -4.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1295   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4143   -3.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4117   -2.7074    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.9882   -3.5327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9868   -5.1839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.8473   -5.1829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5610   -4.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2726   -5.1811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2649   -3.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5547   -3.9467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9859   -3.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9886   -4.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7808   -5.0190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2680   -4.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7766   -3.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0382   -5.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4865   -6.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7433   -7.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5515   -7.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1023   -6.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8426   -5.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8099   -8.1478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.2589   -8.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5143   -9.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3213   -9.7100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8726   -9.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6168   -8.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5768  -10.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864190

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.47Molecular Weight (Monoisotopic): 436.1823AlogP: 3.90#Rotatable Bonds: 4
Polar Surface Area: 69.45Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.44CX Basic pKa: 7.78CX LogP: 4.01CX LogD: 3.76
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.30

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source