The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dichlorophenyl)-9-(3-fluorobenzyl)-3-hydroxy-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one ID: ALA4864193
PubChem CID: 162640914
Max Phase: Preclinical
Molecular Formula: C24H16Cl2FNO4
Molecular Weight: 472.30
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c(O)c(-c2ccc(Cl)c(Cl)c2)oc2c3c(ccc12)OCN(Cc1cccc(F)c1)C3
Standard InChI: InChI=1S/C24H16Cl2FNO4/c25-18-6-4-14(9-19(18)26)23-22(30)21(29)16-5-7-20-17(24(16)32-23)11-28(12-31-20)10-13-2-1-3-15(27)8-13/h1-9,30H,10-12H2
Standard InChI Key: YHKREPOFPNSZAL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
18.9831 -14.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6981 -15.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4119 -13.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4108 -14.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1240 -15.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8429 -14.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8441 -13.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1263 -13.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1217 -15.9765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5564 -15.1549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5580 -13.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2720 -13.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9872 -13.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9896 -12.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2708 -12.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5586 -12.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9842 -13.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6977 -13.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6985 -12.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9874 -12.2690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2739 -12.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2714 -13.5052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9930 -11.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2699 -11.4437 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.2810 -11.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7048 -12.2713 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.2893 -10.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5782 -9.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8597 -10.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8568 -11.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5683 -11.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1406 -11.4365 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17 1 2 0
1 2 1 0
2 4 2 0
3 18 2 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
5 9 2 0
6 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
15 24 1 0
23 25 1 0
14 26 1 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.30Molecular Weight (Monoisotopic): 471.0440AlogP: 5.96#Rotatable Bonds: 3Polar Surface Area: 62.91Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.56CX Basic pKa: 2.81CX LogP: 5.52CX LogD: 5.49Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.78
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]