The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((3-Actylamidopropyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4864268
PubChem CID: 164622664
Max Phase: Preclinical
Molecular Formula: C21H25N7O4
Molecular Weight: 439.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCCCNc1nc(Nc2cc(OC)cc(OC)c2)c(C(N)=O)c2nccn12
Standard InChI: InChI=1S/C21H25N7O4/c1-4-16(29)23-6-5-7-25-21-27-19(17(18(22)30)20-24-8-9-28(20)21)26-13-10-14(31-2)12-15(11-13)32-3/h4,8-12,26H,1,5-7H2,2-3H3,(H2,22,30)(H,23,29)(H,25,27)
Standard InChI Key: PKSARKIQUVBUII-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
35.9889 -15.3445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6715 -14.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4140 -15.2407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6116 -14.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4171 -11.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4171 -12.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1292 -12.8627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8412 -12.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1292 -11.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8381 -11.6276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4519 -11.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1222 -10.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3047 -10.4102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5559 -12.8666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5562 -13.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2709 -14.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7014 -11.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6990 -10.3939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9882 -11.6335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7032 -12.8679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7045 -13.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9893 -14.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9901 -14.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7057 -15.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4220 -14.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4176 -14.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1385 -15.3317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1426 -16.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2760 -15.3416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2768 -16.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2712 -14.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2942 -13.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 6 2 0
5 9 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
8 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
17 18 1 0
17 19 2 0
6 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
25 27 1 0
27 28 1 0
23 29 1 0
29 30 1 0
16 31 1 0
31 1 1 0
4 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.48Molecular Weight (Monoisotopic): 439.1968AlogP: 1.69#Rotatable Bonds: 11Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.71CX Basic pKa: 5.13CX LogP: 1.43CX LogD: 1.42Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.92
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]