The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Icacinlactone M ID: ALA4864288
PubChem CID: 164623195
Max Phase: Preclinical
Molecular Formula: C20H30O4
Molecular Weight: 334.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@]1([C@H](O)CO)CC[C@@H]2C(=C[C@H]3OC(=O)[C@@]4(C)CCC[C@@]2(C)[C@@H]34)C1
Standard InChI: InChI=1S/C20H30O4/c1-18(15(22)11-21)8-5-13-12(10-18)9-14-16-19(13,2)6-4-7-20(16,3)17(23)24-14/h9,13-16,21-22H,4-8,10-11H2,1-3H3/t13-,14-,15-,16-,18-,19-,20+/m1/s1
Standard InChI Key: FVTZTKQWYWZNTP-NCLNHVEOSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
2.1980 -12.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1980 -12.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9067 -11.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6195 -12.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3256 -13.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0433 -12.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3326 -11.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0468 -12.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0638 -10.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3380 -10.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7779 -10.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7645 -11.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7729 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6160 -12.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9085 -13.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0857 -14.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9004 -14.1439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3224 -13.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5351 -14.6796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3255 -12.4332 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3965 -13.6401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7320 -13.9718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5691 -10.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1544 -11.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7752 -9.7888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9458 -10.9406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6195 -11.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 15 1 0
4 3 1 0
4 14 1 0
4 7 1 0
14 5 1 0
5 6 1 0
6 8 2 0
7 8 1 0
7 10 1 0
8 12 1 0
11 9 1 0
9 10 1 0
11 12 1 0
11 13 1 6
14 15 1 0
15 16 1 0
16 17 1 0
5 17 1 0
15 18 1 6
16 19 2 0
7 20 1 1
14 21 1 6
5 22 1 6
11 23 1 0
23 24 1 0
23 25 1 6
24 26 1 0
4 27 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 334.46Molecular Weight (Monoisotopic): 334.2144AlogP: 2.82#Rotatable Bonds: 2Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.87CX Basic pKa: ┄CX LogP: 2.53CX LogD: 2.53Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.60Np Likeness Score: 3.39
References 1. Sun M, Guo B, Xu M, Zhao M, Onakpa MM, Wu Z, Burdette JE, Che CT.. (2021) (9βH)- and 17-Nor-Pimaranes from Icacina oliviformis ., 84 (4.0): [PMID:33769037 ] [10.1021/acs.jnatprod.9b01131 ]