The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-16-alpha-hydroxy-15-beta-((4-methoxybenzoyl)oxy)methylbeyeran-19-oic acid ID: ALA4864335
PubChem CID: 164624934
Max Phase: Preclinical
Molecular Formula: C29H40O6
Molecular Weight: 484.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)OC[C@@H]2[C@@H](O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(C(=O)O)[C@H]5CC[C@@]24C3)cc1
Standard InChI: InChI=1S/C29H40O6/c1-26-14-10-22-27(2)12-5-13-28(3,25(32)33)21(27)11-15-29(22,17-26)20(23(26)30)16-35-24(31)18-6-8-19(34-4)9-7-18/h6-9,20-23,30H,5,10-17H2,1-4H3,(H,32,33)/t20-,21+,22+,23-,26+,27-,28-,29-/m1/s1
Standard InChI Key: RVBTUHRVXDHJTP-GKGCAFNRSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
1.5060 -21.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0981 -22.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9153 -22.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8007 -20.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8007 -21.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5060 -20.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2112 -20.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2078 -21.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9098 -21.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6199 -21.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9168 -20.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6234 -20.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3353 -20.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3468 -19.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6402 -18.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9221 -19.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5075 -23.1989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7325 -22.4899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4941 -20.9663 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.9097 -20.9704 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.0596 -18.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2039 -19.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3253 -20.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0517 -19.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8422 -19.5499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7089 -21.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5256 -21.7261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9100 -22.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7267 -22.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4776 -23.1407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1087 -23.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9246 -23.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3578 -22.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9692 -21.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1545 -21.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1771 -22.5602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5595 -23.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
3 17 1 0
3 18 2 0
8 19 1 1
11 20 1 1
14 21 1 1
7 22 1 6
12 23 1 0
14 24 1 0
23 24 1 0
24 25 1 6
23 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
33 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.63Molecular Weight (Monoisotopic): 484.2825AlogP: 5.33#Rotatable Bonds: 5Polar Surface Area: 93.06Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.58CX Basic pKa: ┄CX LogP: 5.25CX LogD: 2.50Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: 1.70
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]