N-(2,3-Dimethylphenyl)-4-(2-oxo-2-((4-(trifluoromethyl)benzyl)amino)ethoxy)benzamide

ID: ALA4864351

PubChem CID: 164624944

Max Phase: Preclinical

Molecular Formula: C25H23F3N2O3

Molecular Weight: 456.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)c2ccc(OCC(=O)NCc3ccc(C(F)(F)F)cc3)cc2)c1C

Standard InChI:  InChI=1S/C25H23F3N2O3/c1-16-4-3-5-22(17(16)2)30-24(32)19-8-12-21(13-9-19)33-15-23(31)29-14-18-6-10-20(11-7-18)25(26,27)28/h3-13H,14-15H2,1-2H3,(H,29,31)(H,30,32)

Standard InChI Key:  NCPFANVUPJGHEY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   28.2385   -5.2705    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.6512   -4.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8337   -4.5647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.3598   -4.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0648   -4.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7762   -4.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7762   -5.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0666   -6.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3598   -5.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4846   -6.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1917   -5.7942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9000   -6.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6071   -5.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3154   -6.1995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0225   -5.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7280   -6.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4338   -5.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4338   -4.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7204   -4.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0225   -4.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1403   -4.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1403   -3.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8492   -4.9663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5557   -4.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2617   -4.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9677   -4.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9677   -3.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2519   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5557   -3.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6764   -4.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2617   -5.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9000   -7.0189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6512   -3.7497    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
  9  4  2  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 26 30  1  0
 25 31  1  0
 12 32  2  0
  2 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864351

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.46Molecular Weight (Monoisotopic): 456.1661AlogP: 5.27#Rotatable Bonds: 7
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.86CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.70

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source