(R)-((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)(thiophen-3-yl)methanol

ID: ALA4864367

PubChem CID: 164618772

Max Phase: Preclinical

Molecular Formula: C24H26N2O2S

Molecular Weight: 406.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4ccsc4)[C@@]2(C)C3)cc1

Standard InChI:  InChI=1S/C24H26N2O2S/c1-24-13-17-14-25-26(19-6-8-20(28-2)9-7-19)22(17)12-18(24)4-3-5-21(24)23(27)16-10-11-29-15-16/h6-12,14-15,21,23,27H,3-5,13H2,1-2H3/t21-,23+,24+/m1/s1

Standard InChI Key:  LPRCIKPOORTUQC-NHTMILBNSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    6.0428  -27.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7563  -26.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7563  -25.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0428  -25.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3294  -26.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3319  -25.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6200  -25.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6190  -27.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9065  -26.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9053  -25.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1217  -25.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6411  -26.2569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1237  -26.9231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8747  -27.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0655  -27.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8126  -28.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3637  -29.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1751  -29.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4283  -28.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0413  -24.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7566  -24.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3248  -24.1869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8360  -25.2067    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1102  -30.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5081  -24.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0609  -23.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6487  -23.1881    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8412  -23.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3065  -30.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3319  -25.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  8  5  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 14  1  0
  4 20  1  0
 20 21  1  0
 20 22  1  1
  4 23  1  6
 17 24  1  0
 21 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 21  2  0
 24 29  1  0
  6 30  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4864367

    ---

Associated Targets(non-human)

Nr3c1 Glucocorticoid receptor (1330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.55Molecular Weight (Monoisotopic): 406.1715AlogP: 5.42#Rotatable Bonds: 4
Polar Surface Area: 47.28Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.95CX Basic pKa: 1.60CX LogP: 4.74CX LogD: 4.74
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: -0.40

References

1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR..  (2021)  Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion.,  12  (10.0): [PMID:34676039] [10.1021/acsmedchemlett.1c00379]

Source