The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-((4aR,5S)-1-(4-methoxyphenyl)-4a-methyl-4,4a,5,6,7,8-hexahydro-1H-benzo[f]indazol-5-yl)(thiophen-3-yl)methanol ID: ALA4864367
PubChem CID: 164618772
Max Phase: Preclinical
Molecular Formula: C24H26N2O2S
Molecular Weight: 406.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4ccsc4)[C@@]2(C)C3)cc1
Standard InChI: InChI=1S/C24H26N2O2S/c1-24-13-17-14-25-26(19-6-8-20(28-2)9-7-19)22(17)12-18(24)4-3-5-21(24)23(27)16-10-11-29-15-16/h6-12,14-15,21,23,27H,3-5,13H2,1-2H3/t21-,23+,24+/m1/s1
Standard InChI Key: LPRCIKPOORTUQC-NHTMILBNSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
6.0428 -27.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7563 -26.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7563 -25.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0428 -25.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3294 -26.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3319 -25.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6200 -25.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6190 -27.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9065 -26.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9053 -25.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1217 -25.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6411 -26.2569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1237 -26.9231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8747 -27.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0655 -27.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8126 -28.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3637 -29.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1751 -29.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4283 -28.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0413 -24.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7566 -24.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3248 -24.1869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8360 -25.2067 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1102 -30.0614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5081 -24.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0609 -23.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6487 -23.1881 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.8412 -23.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3065 -30.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3319 -25.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 1 0
6 7 1 0
7 10 1 0
9 8 1 0
8 5 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
13 14 1 0
4 20 1 0
20 21 1 0
20 22 1 1
4 23 1 6
17 24 1 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 21 2 0
24 29 1 0
6 30 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.55Molecular Weight (Monoisotopic): 406.1715AlogP: 5.42#Rotatable Bonds: 4Polar Surface Area: 47.28Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.95CX Basic pKa: 1.60CX LogP: 4.74CX LogD: 4.74Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: -0.40
References 1. Kennedy BJ, Lato AM, Fisch AR, Burke SJ, Kirkland JK, Prevatte CW, Dunlap LE, Smith RT, Vogiatzis KD, Collier JJ, Campagna SR.. (2021) Potent Anti-Inflammatory, Arylpyrazole-Based Glucocorticoid Receptor Agonists That Do Not Impair Insulin Secretion., 12 (10.0): [PMID:34676039 ] [10.1021/acsmedchemlett.1c00379 ]