N-(4-((1-Isopropyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)oxy)phenyl)-2,5-dimethylbenzenesulfonamide

ID: ALA4864461

PubChem CID: 164620877

Max Phase: Preclinical

Molecular Formula: C26H25N5O3S

Molecular Weight: 487.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C)c(S(=O)(=O)Nc2ccc(Oc3nc4ccccc4n4c(C(C)C)nnc34)cc2)c1

Standard InChI:  InChI=1S/C26H25N5O3S/c1-16(2)24-28-29-25-26(27-21-7-5-6-8-22(21)31(24)25)34-20-13-11-19(12-14-20)30-35(32,33)23-15-17(3)9-10-18(23)4/h5-16,30H,1-4H3

Standard InChI Key:  RILIYLBMRDNBTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   18.6061  -17.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9928  -10.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8828  -14.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0270  -14.5371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5280  -16.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5295  -15.5145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0167  -11.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3153  -16.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6044  -17.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3186  -18.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8853  -13.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1686  -12.8887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0286  -15.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0155  -16.1832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3137  -15.7760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0320  -17.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6963  -10.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5994  -14.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9657  -12.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0336  -17.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3131  -12.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4438  -11.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7453  -15.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4218  -10.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1654  -12.0602    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7470  -16.5982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3145  -14.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7421  -12.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3129  -13.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5962  -12.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7867  -17.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7487  -11.4728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2426  -18.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5867  -17.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1182  -10.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  2  0
  8  9  1  0
 17  2  1  0
 11  3  2  0
 13 15  2  0
 26 23  1  0
  5 31  1  0
 19 25  2  0
 22 24  1  0
 23 13  1  0
 10 20  2  0
 27 18  2  0
 30 29  2  0
 14  6  1  0
  7 28  1  0
 27  4  1  0
 18  3  1  0
 15  8  1  0
 24 17  2  0
 26 16  1  0
 12 11  1  0
 14  5  2  0
 29 27  1  0
 25 32  2  0
 22 28  2  0
 25 12  1  0
  9  1  2  0
 11 30  1  0
 26  5  1  0
  8 16  2  0
 20 16  1  0
  1 10  1  0
 23  6  2  0
  7 21  1  0
  4 13  1  0
 22 25  1  0
 31 33  1  0
 31 34  1  0
 24 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864461

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 487.59Molecular Weight (Monoisotopic): 487.1678AlogP: 5.61#Rotatable Bonds: 6
Polar Surface Area: 98.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.09CX Basic pKa: 1.44CX LogP: 4.96CX LogD: 4.89
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.83

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source