1,1-diisopropyl-3-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]urea

ID: ALA4864484

PubChem CID: 164621701

Max Phase: Preclinical

Molecular Formula: C27H37N3O5

Molecular Weight: 483.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1ccc2c(cc1=O)[C@@H](NC(=O)N(C(C)C)C(C)C)CCc1cc(OC)c(OC)c(OC)c1-2

Standard InChI:  InChI=1S/C27H37N3O5/c1-15(2)30(16(3)4)27(32)29-20-11-9-17-13-23(33-6)25(34-7)26(35-8)24(17)18-10-12-21(28-5)22(31)14-19(18)20/h10,12-16,20H,9,11H2,1-8H3,(H,28,31)(H,29,32)/t20-/m0/s1

Standard InChI Key:  SGRRISGRTRJVNE-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    3.3747  -23.7274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3735  -24.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0774  -24.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0756  -23.3227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7835  -24.5420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7843  -23.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4262  -23.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2273  -23.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5804  -24.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4262  -25.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2297  -24.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8789  -25.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0655  -25.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8841  -26.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4290  -26.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2380  -26.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4216  -27.5173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8238  -28.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6171  -26.5644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3935  -24.1262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8005  -23.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6136  -23.4158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3904  -22.7149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0783  -25.7648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6696  -24.9508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6710  -23.3231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6708  -22.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9663  -24.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3751  -26.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0237  -24.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0206  -22.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8378  -22.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6105  -22.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6167  -24.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8409  -24.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  5  2  0
  6  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  5 10  1  0
  7  8  1  0
  8  9  1  0
 11  9  1  0
 10 11  1  0
 11 12  2  0
 10 13  2  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 14 19  2  0
  9 20  1  6
 20 21  1  0
 21 22  1  0
 21 23  2  0
  3 24  1  0
  2 25  1  0
  1 26  1  0
 26 27  1  0
 25 28  1  0
 24 29  1  0
 22 30  1  0
 22 31  1  0
 31 32  1  0
 31 33  1  0
 30 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864484

    ---

Associated Targets(Human)

LoVo (4724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BALB/3T3 (534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.61Molecular Weight (Monoisotopic): 483.2733AlogP: 4.60#Rotatable Bonds: 7
Polar Surface Area: 89.13Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.80CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: 0.27

References

1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A..  (2021)  Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties.,  47  [PMID:34116158] [10.1016/j.bmcl.2021.128197]

Source