The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1-diisopropyl-3-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]urea ID: ALA4864484
PubChem CID: 164621701
Max Phase: Preclinical
Molecular Formula: C27H37N3O5
Molecular Weight: 483.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=O)N(C(C)C)C(C)C)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C27H37N3O5/c1-15(2)30(16(3)4)27(32)29-20-11-9-17-13-23(33-6)25(34-7)26(35-8)24(17)18-10-12-21(28-5)22(31)14-19(18)20/h10,12-16,20H,9,11H2,1-8H3,(H,28,31)(H,29,32)/t20-/m0/s1
Standard InChI Key: SGRRISGRTRJVNE-FQEVSTJZSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
3.3747 -23.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3735 -24.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0774 -24.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0756 -23.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7835 -24.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7843 -23.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4262 -23.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2273 -23.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5804 -24.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4262 -25.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2297 -24.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8789 -25.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0655 -25.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8841 -26.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4290 -26.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2380 -26.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4216 -27.5173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8238 -28.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6171 -26.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3935 -24.1262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8005 -23.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6136 -23.4158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3904 -22.7149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0783 -25.7648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6696 -24.9508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6710 -23.3231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6708 -22.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9663 -24.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3751 -26.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0237 -24.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0206 -22.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8378 -22.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6105 -22.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6167 -24.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8409 -24.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
3 24 1 0
2 25 1 0
1 26 1 0
26 27 1 0
25 28 1 0
24 29 1 0
22 30 1 0
22 31 1 0
31 32 1 0
31 33 1 0
30 34 1 0
30 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.61Molecular Weight (Monoisotopic): 483.2733AlogP: 4.60#Rotatable Bonds: 7Polar Surface Area: 89.13Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.80CX LogP: 2.81CX LogD: 2.81Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: 0.27
References 1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A.. (2021) Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties., 47 [PMID:34116158 ] [10.1016/j.bmcl.2021.128197 ]