The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(2,4-Diamino-pteridin-6-ylmethyl)-methyl-amino]-benzoylamino}-hexanedioic acid ID: ALA48645
PubChem CID: 10479741
Max Phase: Preclinical
Molecular Formula: C21H24N8O5
Molecular Weight: 468.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCC(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C21H24N8O5/c1-29(10-12-9-24-18-16(25-12)17(22)27-21(23)28-18)13-7-5-11(6-8-13)19(32)26-14(20(33)34)3-2-4-15(30)31/h5-9,14H,2-4,10H2,1H3,(H,26,32)(H,30,31)(H,33,34)(H4,22,23,24,27,28)
Standard InChI Key: UGECVWNCMVBWTJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
1.4500 -3.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9292 -4.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9292 -3.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4500 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 -3.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9292 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 -4.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4500 -1.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6208 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 -2.4875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4000 -1.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0042 0.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9292 -0.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -2.1750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6208 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0042 1.1333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9292 -2.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4000 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1125 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1125 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 -1.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 -4.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9917 -1.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5292 0.2333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4875 0.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4875 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6625 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 2 0
3 5 1 0
4 2 1 0
5 1 2 0
6 1 1 0
7 3 1 0
8 15 1 0
9 4 1 0
10 8 1 0
11 7 2 0
12 14 1 0
13 16 1 0
14 10 1 0
15 25 1 0
16 11 1 0
17 13 1 0
18 31 1 0
19 8 2 0
20 12 2 0
21 9 2 0
22 18 2 0
23 5 1 0
24 26 1 0
25 27 2 0
26 17 2 0
27 17 1 0
28 6 1 0
29 12 1 0
30 18 1 0
31 32 1 0
32 34 1 0
33 13 1 0
34 14 1 0
4 3 2 0
21 11 1 0
24 15 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.47Molecular Weight (Monoisotopic): 468.1870AlogP: 0.66#Rotatable Bonds: 10Polar Surface Area: 210.54Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.31CX Basic pKa: 2.83CX LogP: 0.23CX LogD: -6.09Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -0.48
References 1. Rosowsky A, Forsch R, Uren J, Wick M, Kumar AA, Freisheim JH.. (1983) Methotrexate analogues. 20. Replacement of glutamate by longer-chain amino diacids: effects on dihydrofolate reductase inhibition, cytotoxicity, and in vivo antitumor activity., 26 (12): [PMID:6139480 ] [10.1021/jm00366a012 ]