[4-(trifluoromethyl)phenyl]methyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate

ID: ALA4864567

PubChem CID: 164624519

Max Phase: Preclinical

Molecular Formula: C29H29F3N2O6

Molecular Weight: 558.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1ccc2c(cc1=O)[C@@H](NC(=O)OCc1ccc(C(F)(F)F)cc1)CCc1cc(OC)c(OC)c(OC)c1-2

Standard InChI:  InChI=1S/C29H29F3N2O6/c1-33-22-12-10-19-20(14-23(22)35)21(11-7-17-13-24(37-2)26(38-3)27(39-4)25(17)19)34-28(36)40-15-16-5-8-18(9-6-16)29(30,31)32/h5-6,8-10,12-14,21H,7,11,15H2,1-4H3,(H,33,35)(H,34,36)/t21-/m0/s1

Standard InChI Key:  RIKWPXSCMQCUFK-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   14.3778   -2.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3767   -3.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0806   -3.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0788   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7867   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7875   -2.4686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4294   -1.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2305   -2.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5836   -2.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4293   -3.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2329   -3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8820   -4.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0686   -4.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8872   -4.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4322   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2412   -5.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4248   -6.2620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8270   -6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6203   -5.3092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3967   -2.8710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0815   -4.5096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6728   -3.6956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6742   -2.0679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6740   -1.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9695   -3.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3783   -4.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8037   -2.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6209   -2.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3936   -1.4556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0310   -2.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8482   -2.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2545   -3.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0709   -3.5729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4788   -2.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0643   -2.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2492   -2.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2960   -2.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7071   -3.5672    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.7021   -2.1518    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.1113   -2.8602    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  5  2  0
  6  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  5 10  1  0
  7  8  1  0
  8  9  1  0
 11  9  1  0
 10 11  1  0
 11 12  2  0
 10 13  2  0
 12 14  1  0
 13 15  1  0
 14 16  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 14 19  2  0
  9 20  1  6
  3 21  1  0
  2 22  1  0
  1 23  1  0
 23 24  1  0
 22 25  1  0
 21 26  1  0
 20 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864567

    ---

Associated Targets(Human)

LoVo (4724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BALB/3T3 (534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.55Molecular Weight (Monoisotopic): 558.1978AlogP: 5.71#Rotatable Bonds: 7
Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.50CX Basic pKa: 3.80CX LogP: 4.37CX LogD: 4.37
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: 0.09

References

1. Krzywik J, Aminpour M, Janczak J, Maj E, Moshari M, Mozga W, Wietrzyk J, Tuszyński JA, Huczyński A..  (2021)  An insight into the anticancer potential of carbamates and thiocarbamates of 10-demethoxy-10-methylaminocolchicine.,  215  [PMID:33611191] [10.1016/j.ejmech.2021.113282]

Source