The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-(trifluoromethyl)phenyl]methyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate ID: ALA4864567
PubChem CID: 164624519
Max Phase: Preclinical
Molecular Formula: C29H29F3N2O6
Molecular Weight: 558.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=O)OCc1ccc(C(F)(F)F)cc1)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C29H29F3N2O6/c1-33-22-12-10-19-20(14-23(22)35)21(11-7-17-13-24(37-2)26(38-3)27(39-4)25(17)19)34-28(36)40-15-16-5-8-18(9-6-16)29(30,31)32/h5-6,8-10,12-14,21H,7,11,15H2,1-4H3,(H,33,35)(H,34,36)/t21-/m0/s1
Standard InChI Key: RIKWPXSCMQCUFK-NRFANRHFSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
14.3778 -2.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3767 -3.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0806 -3.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0788 -2.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7867 -3.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7875 -2.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4294 -1.9548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2305 -2.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5836 -2.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4293 -3.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2329 -3.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8820 -4.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0686 -4.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8872 -4.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4322 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2412 -5.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4248 -6.2620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8270 -6.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6203 -5.3092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3967 -2.8710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0815 -4.5096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6728 -3.6956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6742 -2.0679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6740 -1.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9695 -3.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3783 -4.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8037 -2.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6209 -2.1606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3936 -1.4556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0310 -2.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8482 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2545 -3.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0709 -3.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4788 -2.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0643 -2.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2492 -2.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2960 -2.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7071 -3.5672 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.7021 -2.1518 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.1113 -2.8602 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
3 21 1 0
2 22 1 0
1 23 1 0
23 24 1 0
22 25 1 0
21 26 1 0
20 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.55Molecular Weight (Monoisotopic): 558.1978AlogP: 5.71#Rotatable Bonds: 7Polar Surface Area: 95.12Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.50CX Basic pKa: 3.80CX LogP: 4.37CX LogD: 4.37Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: 0.09
References 1. Krzywik J, Aminpour M, Janczak J, Maj E, Moshari M, Mozga W, Wietrzyk J, Tuszyński JA, Huczyński A.. (2021) An insight into the anticancer potential of carbamates and thiocarbamates of 10-demethoxy-10-methylaminocolchicine., 215 [PMID:33611191 ] [10.1016/j.ejmech.2021.113282 ]