N-(5,6-Dimethoxy-benzothiazol-2-yl)-2,2-diphenyl-acetamide

ID: ALA4864689

PubChem CID: 7542982

Max Phase: Preclinical

Molecular Formula: C23H20N2O3S

Molecular Weight: 404.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2nc(NC(=O)C(c3ccccc3)c3ccccc3)sc2cc1OC

Standard InChI:  InChI=1S/C23H20N2O3S/c1-27-18-13-17-20(14-19(18)28-2)29-23(24-17)25-22(26)21(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,21H,1-2H3,(H,24,25,26)

Standard InChI Key:  LZZWZSFVQWDIQD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    6.4109   -7.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4097   -8.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1245   -8.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1227   -6.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8381   -7.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8429   -8.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6303   -8.2900    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.1123   -7.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6226   -6.9529    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6964   -6.8041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6949   -8.4557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9373   -7.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3455   -6.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1705   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9288   -6.1848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6962   -5.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6943   -9.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5872   -7.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5788   -6.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4046   -6.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8127   -5.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3960   -4.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5668   -4.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1623   -5.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1760   -8.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5920   -9.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4178   -9.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8258   -8.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4075   -7.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
  2 11  1  0
  8 12  1  0
 12 13  1  0
 14 13  1  0
 13 15  2  0
 10 16  1  0
 11 17  1  0
 14 18  1  0
 14 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 18 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 18  1  0
M  END

Associated Targets(non-human)

Zika virus (1028 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
dengue virus type 2 (2400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.49Molecular Weight (Monoisotopic): 404.1195AlogP: 5.08#Rotatable Bonds: 6
Polar Surface Area: 60.45Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.81CX Basic pKa: 0.12CX LogP: 5.23CX LogD: 5.10
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.33

References

1. Maus H, Barthels F, Hammerschmidt SJ, Kopp K, Millies B, Gellert A, Ruggieri A, Schirmeister T..  (2021)  SAR of novel benzothiazoles targeting an allosteric pocket of DENV and ZIKV NS2B/NS3 proteases.,  47  [PMID:34509861] [10.1016/j.bmc.2021.116392]

Source