The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(6-amino-5-(1-oxo-1,2,3,4-tetrahydroisoquinolin-6-yl)pyridin-3-yl)-N-ethyl-4-fluorobenzamide ID: ALA4864704
PubChem CID: 122588283
Max Phase: Preclinical
Molecular Formula: C23H21FN4O2
Molecular Weight: 404.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)c1ccc(F)c(-c2cnc(N)c(-c3ccc4c(c3)CCNC4=O)c2)c1
Standard InChI: InChI=1S/C23H21FN4O2/c1-2-26-22(29)15-4-6-20(24)18(10-15)16-11-19(21(25)28-12-16)13-3-5-17-14(9-13)7-8-27-23(17)30/h3-6,9-12H,2,7-8H2,1H3,(H2,25,28)(H,26,29)(H,27,30)
Standard InChI Key: OXGXHAZYCPYPIR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
10.9495 -13.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6580 -8.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3660 -8.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0743 -8.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0743 -9.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3686 -10.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6580 -9.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9458 -10.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2375 -9.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5330 -10.1280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5330 -10.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2350 -11.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9458 -10.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2350 -12.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9471 -12.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2335 -13.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5293 -13.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5225 -12.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8145 -12.1765 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2375 -8.8976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7824 -10.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4905 -9.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4905 -8.8963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7824 -8.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7824 -7.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6569 -13.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6561 -14.6276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3650 -13.4024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0723 -13.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7804 -13.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
14 12 1 0
15 14 2 0
1 15 1 0
16 1 2 0
17 16 1 0
18 17 2 0
14 18 1 0
18 19 1 0
9 20 1 0
5 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
4 24 1 0
24 25 2 0
1 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.45Molecular Weight (Monoisotopic): 404.1649AlogP: 3.17#Rotatable Bonds: 4Polar Surface Area: 97.11Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.82CX LogP: 2.50CX LogD: 2.49Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -0.61
References 1. (2020) STK4 inhibitors for treatment of hematologic malignancies,