The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-bromo-3-ethyl-2-((R)-1-((S)-3-methylpiperazin-1-yl)butyl)quinazolin-4(3H)-one ID: ALA4864739
PubChem CID: 147197912
Max Phase: Preclinical
Molecular Formula: C19H27BrN4O
Molecular Weight: 407.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@H](c1nc2ccc(Br)cc2c(=O)n1CC)N1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C19H27BrN4O/c1-4-6-17(23-10-9-21-13(3)12-23)18-22-16-8-7-14(20)11-15(16)19(25)24(18)5-2/h7-8,11,13,17,21H,4-6,9-10,12H2,1-3H3/t13-,17+/m0/s1
Standard InChI Key: CCSYRVYORQUIJU-SUMWQHHRSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
19.5245 -10.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5234 -11.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2314 -12.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2296 -10.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9382 -10.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9370 -11.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6471 -12.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3630 -11.7649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3642 -10.9397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6495 -10.5238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6448 -12.9914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0729 -10.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7796 -10.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0695 -12.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0749 -9.7156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7912 -9.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7951 -8.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0902 -8.0836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3797 -8.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3741 -9.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4883 -10.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1950 -10.9466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7784 -11.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8153 -12.1688 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
24.5053 -8.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
8 14 1 0
12 15 1 6
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
13 21 1 0
21 22 1 0
14 23 1 0
2 24 1 0
17 25 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.36Molecular Weight (Monoisotopic): 406.1368AlogP: 3.31#Rotatable Bonds: 5Polar Surface Area: 50.16Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.30CX LogP: 3.43CX LogD: 1.54Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.83Np Likeness Score: -0.91
References 1. Fernández A, Díaz JL, García M, Rodríguez-Escrich S, Lorente A, Enrech R, Dordal A, Portillo-Salido E, Porras M, Fernández B, Reinoso RF, Vela JM, Almansa C.. (2021) Piperazinyl Bicyclic Derivatives as Selective Ligands of the α2δ-1 Subunit of Voltage-Gated Calcium Channels., 12 (11.0): [PMID:34795870 ] [10.1021/acsmedchemlett.1c00416 ]