(S)-N-(1-phenylethyl)-6-(quinolin-6-yl)imidazo[1,2-a]pyridine-3-carboxamide

ID: ALA4864799

PubChem CID: 164624532

Max Phase: Preclinical

Molecular Formula: C25H20N4O

Molecular Weight: 392.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)c1cnc2ccc(-c3ccc4ncccc4c3)cn12)c1ccccc1

Standard InChI:  InChI=1S/C25H20N4O/c1-17(18-6-3-2-4-7-18)28-25(30)23-15-27-24-12-10-21(16-29(23)24)19-9-11-22-20(14-19)8-5-13-26-22/h2-17H,1H3,(H,28,30)/t17-/m0/s1

Standard InChI Key:  CWDLHHZOVVUFGK-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   16.1446   -7.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1446   -8.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8588   -8.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8588   -6.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5729   -7.2678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5729   -8.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3566   -8.3464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8409   -7.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3566   -7.0133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4292   -6.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6124   -6.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4218   -6.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0587   -5.6113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6776   -5.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4869   -5.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0388   -5.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8475   -5.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1040   -4.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5454   -4.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7388   -4.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4292   -6.0340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0049   -6.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7200   -7.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0002   -6.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7123   -5.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7118   -4.8069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9999   -4.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2871   -4.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2912   -5.6307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1239   -4.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  1
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 10  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  2  0
 14 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864799

    ---

Associated Targets(Human)

CLK1 Tchem Dual specificty protein kinase CLK1 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.46Molecular Weight (Monoisotopic): 392.1637AlogP: 5.04#Rotatable Bonds: 4
Polar Surface Area: 59.29Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.83CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.35

References

1. Zhang Y, Xia A, Zhang S, Lin G, Liu J, Chen P, Mu B, Jiao Y, Xu W, Chen M, Li L..  (2021)  Discovery of 3,6-disubstutited-imidazo[1,2-a]pyridine derivatives as a new class of CLK1 inhibitors.,  41  [PMID:33662541] [10.1016/j.bmcl.2021.127881]

Source