6-(1H-indol-3-yl)-1-((tetrahydrofuran-3-yl)methyl)-1H-benzo[d][1,2,3]triazole

ID: ALA4864828

PubChem CID: 164625536

Max Phase: Preclinical

Molecular Formula: C19H18N4O

Molecular Weight: 318.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc2c(-c3ccc4c(c3)nnn4CC3CCOC3)c[nH]c2c1

Standard InChI:  InChI=1S/C19H18N4O/c1-2-4-17-15(3-1)16(10-20-17)14-5-6-19-18(9-14)21-22-23(19)11-13-7-8-24-12-13/h1-6,9-10,13,20H,7-8,11-12H2

Standard InChI Key:  OLBNVQLQXDSGNV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 28  0  0  0  0  0  0  0  0999 V2000
   37.5729  -19.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5717  -19.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2798  -20.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2780  -18.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9866  -19.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9914  -19.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7714  -20.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.2488  -19.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7637  -18.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0116  -17.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8118  -17.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7073  -16.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4630  -17.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5117  -16.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0569  -17.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8015  -16.7096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7165  -15.8991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9194  -15.7296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5872  -14.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0676  -14.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8829  -14.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1356  -13.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4745  -13.0639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8134  -13.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4864828

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.38Molecular Weight (Monoisotopic): 318.1481AlogP: 3.62#Rotatable Bonds: 3
Polar Surface Area: 55.73Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.32CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.03

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source