The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-cyclohexyl-7-(3,5-dimethylisoxazol-4-yl)-2-(4-methoxybenzyl)imidazo[1,2-a]pyridin-3-amine ID: ALA4864902
PubChem CID: 146589317
Max Phase: Preclinical
Molecular Formula: C26H30N4O2
Molecular Weight: 430.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nc3cc(-c4c(C)noc4C)ccn3c2NC2CCCCC2)cc1
Standard InChI: InChI=1S/C26H30N4O2/c1-17-25(18(2)32-29-17)20-13-14-30-24(16-20)28-23(15-19-9-11-22(31-3)12-10-19)26(30)27-21-7-5-4-6-8-21/h9-14,16,21,27H,4-8,15H2,1-3H3
Standard InChI Key: WLQHDQWZFZLQMZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
6.8015 -14.9565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3528 -16.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3519 -16.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0601 -17.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0578 -15.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7665 -16.0025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7716 -16.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -17.0693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0288 -16.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5435 -15.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6483 -17.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9019 -16.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3548 -17.5095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7631 -18.2174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5625 -18.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7324 -16.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1696 -18.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8460 -16.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2560 -14.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5165 -13.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9748 -12.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1739 -13.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9176 -13.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4621 -14.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2590 -17.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8520 -17.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2643 -18.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0823 -18.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4863 -17.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0717 -17.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4962 -19.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3134 -19.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 7 1 0
6 5 1 0
5 2 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 6 1 0
10 1 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 2 0
3 11 1 0
12 16 1 0
15 17 1 0
9 18 1 0
1 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
18 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.55Molecular Weight (Monoisotopic): 430.2369AlogP: 5.95#Rotatable Bonds: 6Polar Surface Area: 64.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.07CX LogP: 4.27CX LogD: 4.11Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.06
References 1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W.. (2021) Development of Dimethylisoxazole-Attached Imidazo[1,2-a ]pyridines as Potent and Selective CBP/P300 Inhibitors., 64 (9.0): [PMID:33872011 ] [10.1021/acs.jmedchem.0c02232 ]