The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4,5-Dichloro-6-oxopyridazin-1(6H)-yl)-N-(4-methoxy-3-(N-(2-(pyridin-2-yl)ethyl)sulfamoyl)phenyl)acetamide ID: ALA4864955
PubChem CID: 162727710
Max Phase: Preclinical
Molecular Formula: C20H19Cl2N5O5S
Molecular Weight: 512.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1S(=O)(=O)NCCc1ccccn1
Standard InChI: InChI=1S/C20H19Cl2N5O5S/c1-32-16-6-5-14(26-18(28)12-27-20(29)19(22)15(21)11-24-27)10-17(16)33(30,31)25-9-7-13-4-2-3-8-23-13/h2-6,8,10-11,25H,7,9,12H2,1H3,(H,26,28)
Standard InChI Key: HKAOMTAACNGHGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
11.8576 -19.4613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2742 -18.7488 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.4489 -18.7442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9894 -19.1613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9882 -19.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7030 -20.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4194 -19.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4166 -19.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7012 -18.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2747 -17.9240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1295 -18.7424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8454 -19.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5583 -18.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8485 -19.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2742 -19.1468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2742 -19.9707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9893 -20.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7033 -19.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6974 -19.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9818 -18.7300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9749 -17.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4088 -18.7183 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.4197 -20.3740 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.9893 -17.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9898 -16.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7045 -16.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4169 -16.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1310 -16.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1319 -15.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4127 -15.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7014 -15.4551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2735 -20.4005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5594 -19.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 2 1 0
2 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 1 0
20 21 2 0
19 22 1 0
18 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
5 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.38Molecular Weight (Monoisotopic): 511.0484AlogP: 2.11#Rotatable Bonds: 9Polar Surface Area: 132.28Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.48CX Basic pKa: 4.54CX LogP: 1.40CX LogD: 1.40Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -2.49
References 1. McKinney DC, McMillan BJ, Ranaghan MJ, Moroco JA, Brousseau M, Mullin-Bernstein Z, O'Keefe M, McCarren P, Mesleh MF, Mulvaney KM, Robinson F, Singh R, Bajrami B, Wagner FF, Hilgraf R, Drysdale MJ, Campbell AJ, Skepner A, Timm DE, Porter D, Kaushik VK, Sellers WR, Ianari A.. (2021) Discovery of a First-in-Class Inhibitor of the PRMT5-Substrate Adaptor Interaction., 64 (15.0): [PMID:34342224 ] [10.1021/acs.jmedchem.1c00507 ]