The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[4-(4,4'-Dimethoxytrityloxy)-2-oxabutyl]-5-bromouracil ID: ALA4865141
PubChem CID: 164621364
Max Phase: Preclinical
Molecular Formula: C28H29BrN2O6
Molecular Weight: 569.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(OCCOCN2C=C(Br)C(O)NC2=O)(c2ccccc2)c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C28H29BrN2O6/c1-34-23-12-8-21(9-13-23)28(20-6-4-3-5-7-20,22-10-14-24(35-2)15-11-22)37-17-16-36-19-31-18-25(29)26(32)30-27(31)33/h3-15,18,26,32H,16-17,19H2,1-2H3,(H,30,33)
Standard InChI Key: SFWKQVPBYXKBAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
6.7655 -7.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9705 -6.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3766 -7.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5765 -8.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3757 -8.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9660 -7.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7416 -6.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3333 -7.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 -2.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4792 -3.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1911 -3.4333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9031 -3.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9031 -2.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1911 -1.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7635 -1.7896 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.6170 -3.4385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1911 -0.9584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1911 -4.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9057 -4.6708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9057 -5.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6201 -5.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6201 -6.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3346 -7.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5675 -6.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9758 -5.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5593 -4.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7301 -5.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3257 -5.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6178 -8.3813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6187 -9.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3343 -9.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0506 -9.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0461 -8.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -4.2811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7916 -4.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7598 -8.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9618 -9.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
8 7 1 0
3 8 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 15 1 0
12 16 2 0
14 17 1 0
11 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 8 1 0
8 23 1 0
7 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 7 1 0
23 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 23 1 0
26 34 1 0
34 35 1 0
6 36 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.45Molecular Weight (Monoisotopic): 568.1209AlogP: 4.57#Rotatable Bonds: 11Polar Surface Area: 89.49Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.12CX Basic pKa: ┄CX LogP: 4.33CX LogD: 4.33Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.14
References 1. Kozlovskaya LI, Volok VP, Shtro AA, Nikolaeva YV, Chistov AA, Matyugina ES, Belyaev ES, Jegorov AV, Snoeck R, Korshun VA, Andrei G, Osolodkin DI, Ishmukhametov AA, Aralov AV.. (2021) Phenoxazine nucleoside derivatives with a multiple activity against RNA and DNA viruses., 220 [PMID:33894564 ] [10.1016/j.ejmech.2021.113467 ]