(2S)-2-[[(2S)-2-[(3-cyano-1,4-dioxo-2-naphthyl)amino]-3-phenyl-propanoyl]amino]-4-methyl-pentanoic acid

ID: ALA4865195

PubChem CID: 164622239

Max Phase: Preclinical

Molecular Formula: C26H25N3O5

Molecular Weight: 459.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC1=C(C#N)C(=O)c2ccccc2C1=O)C(=O)O

Standard InChI:  InChI=1S/C26H25N3O5/c1-15(2)12-21(26(33)34)29-25(32)20(13-16-8-4-3-5-9-16)28-22-19(14-27)23(30)17-10-6-7-11-18(17)24(22)31/h3-11,15,20-21,28H,12-13H2,1-2H3,(H,29,32)(H,33,34)/t20-,21-/m0/s1

Standard InChI Key:  DEBONYYJRIZVEX-SFTDATJTSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    8.0833   -4.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9402   -5.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9391   -6.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6538   -6.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6520   -4.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3674   -5.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3663   -6.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0832   -6.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8070   -5.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8039   -6.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5217   -6.4389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0803   -7.2571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0822   -3.9374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5199   -4.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2363   -4.3673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2376   -6.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9506   -6.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2888   -5.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9716   -4.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6883   -5.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4002   -4.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3960   -4.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6739   -3.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9649   -4.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9475   -7.2691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6665   -6.0342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3795   -6.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0955   -6.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3765   -7.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0894   -7.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0864   -8.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8054   -7.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8084   -6.4546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0985   -5.2144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  6  1  1  0
  7  8  1  0
  8 10  1  0
  9  1  1  0
  9 10  2  0
 10 11  1  0
  8 12  2  0
  1 13  2  0
 14 15  3  0
  9 14  1  0
 11 16  1  0
 16 17  1  0
 16 18  1  1
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  2  0
 17 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  6
 29 30  1  0
 30 31  1  0
 30 32  1  0
 28 33  1  0
 28 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4865195

    ---

Associated Targets(non-human)

rhodesain Rhodesain (1463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.1794AlogP: 2.66#Rotatable Bonds: 9
Polar Surface Area: 136.36Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.28CX Basic pKa: CX LogP: 3.00CX LogD: -0.43
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.17

References

1. Silva LR, Guimarães AS, do Nascimento J, do Santos Nascimento IJ, da Silva EB, McKerrow JH, Cardoso SH, da Silva-Júnior EF..  (2021)  Computer-aided design of 1,4-naphthoquinone-based inhibitors targeting cruzain and rhodesain cysteine proteases.,  41  [PMID:33992862] [10.1016/j.bmc.2021.116213]

Source