The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-2-[(3-cyano-1,4-dioxo-2-naphthyl)amino]-3-phenyl-propanoyl]amino]-4-methyl-pentanoic acid ID: ALA4865195
PubChem CID: 164622239
Max Phase: Preclinical
Molecular Formula: C26H25N3O5
Molecular Weight: 459.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC1=C(C#N)C(=O)c2ccccc2C1=O)C(=O)O
Standard InChI: InChI=1S/C26H25N3O5/c1-15(2)12-21(26(33)34)29-25(32)20(13-16-8-4-3-5-9-16)28-22-19(14-27)23(30)17-10-6-7-11-18(17)24(22)31/h3-11,15,20-21,28H,12-13H2,1-2H3,(H,29,32)(H,33,34)/t20-,21-/m0/s1
Standard InChI Key: DEBONYYJRIZVEX-SFTDATJTSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
8.0833 -4.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9402 -5.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9391 -6.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6538 -6.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6520 -4.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3674 -5.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3663 -6.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0832 -6.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8070 -5.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8039 -6.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5217 -6.4389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0803 -7.2571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0822 -3.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5199 -4.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2363 -4.3673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2376 -6.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9506 -6.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2888 -5.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9716 -4.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6883 -5.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4002 -4.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3960 -4.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6739 -3.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9649 -4.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9475 -7.2691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6665 -6.0342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3795 -6.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0955 -6.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3765 -7.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0894 -7.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0864 -8.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8054 -7.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8084 -6.4546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0985 -5.2144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 1 1 0
7 8 1 0
8 10 1 0
9 1 1 0
9 10 2 0
10 11 1 0
8 12 2 0
1 13 2 0
14 15 3 0
9 14 1 0
11 16 1 0
16 17 1 0
16 18 1 1
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 2 0
17 26 1 0
26 27 1 0
27 28 1 0
27 29 1 6
29 30 1 0
30 31 1 0
30 32 1 0
28 33 1 0
28 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.1794AlogP: 2.66#Rotatable Bonds: 9Polar Surface Area: 136.36Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.28CX Basic pKa: ┄CX LogP: 3.00CX LogD: -0.43Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.17
References 1. Silva LR, Guimarães AS, do Nascimento J, do Santos Nascimento IJ, da Silva EB, McKerrow JH, Cardoso SH, da Silva-Júnior EF.. (2021) Computer-aided design of 1,4-naphthoquinone-based inhibitors targeting cruzain and rhodesain cysteine proteases., 41 [PMID:33992862 ] [10.1016/j.bmc.2021.116213 ]