The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3beta-acetoxy-11-oxo-18beta11-olean-12-en-30-oic acid 3-quinolinyl amide ID: ALA4865221
PubChem CID: 164623209
Max Phase: Preclinical
Molecular Formula: C41H54N2O4
Molecular Weight: 638.89
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2C(=O)C=C2C4C[C@@](C)(C(=O)Nc5cnc6ccccc6c5)CC[C@]4(C)CC[C@]23C)C1(C)C
Standard InChI: InChI=1S/C41H54N2O4/c1-25(44)47-33-14-15-39(6)32(36(33,2)3)13-16-41(8)34(39)31(45)22-28-29-23-38(5,18-17-37(29,4)19-20-40(28,41)7)35(46)43-27-21-26-11-9-10-12-30(26)42-24-27/h9-12,21-22,24,29,32-34H,13-20,23H2,1-8H3,(H,43,46)/t29?,32?,33-,34?,37+,38-,39-,40+,41+/m0/s1
Standard InChI Key: XAQVSOGYDHLHGA-FFTJLYNLSA-N
Molfile:
RDKit 2D
47 53 0 0 0 0 0 0 0 0999 V2000
2.7374 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7374 -7.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4494 -7.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4494 -5.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1613 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1624 -7.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8734 -7.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5879 -7.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8713 -5.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5888 -6.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5875 -4.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8675 -5.1285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3051 -5.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3040 -5.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0171 -6.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7357 -5.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0192 -4.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7363 -5.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4564 -4.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4658 -3.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7488 -3.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0223 -3.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3287 -2.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1580 -2.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1276 -3.0889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1074 -2.0885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8582 -8.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0289 -8.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1539 -5.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5831 -5.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0236 -7.6089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3085 -7.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5969 -7.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3073 -6.3726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2997 -6.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7053 -2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5042 -2.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0640 -1.1202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4820 -1.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8634 -1.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0787 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8725 -2.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4566 -1.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2413 -0.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4418 -0.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1526 -4.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4454 -5.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 2 0
11 12 1 0
13 14 1 0
13 17 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 1
21 24 1 0
23 25 1 0
23 26 2 0
3 27 1 0
3 28 1 0
5 29 1 1
10 30 1 1
2 31 1 1
31 32 1 0
32 33 1 0
32 34 2 0
14 35 1 6
25 36 1 0
36 37 2 0
36 39 1 0
37 41 1 0
40 38 1 0
38 39 2 0
40 41 2 0
40 45 1 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
12 46 2 0
18 47 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 638.89Molecular Weight (Monoisotopic): 638.4084AlogP: 9.09#Rotatable Bonds: 3Polar Surface Area: 85.36Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.37CX Basic pKa: 3.63CX LogP: 8.06CX LogD: 8.06Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.34Np Likeness Score: 1.79
References 1. Baltina LA, Lai HC, Liu YC, Huang SH, Hour MJ, Baltina LA, Nugumanov TR, Borisevich SS, Khalilov LM, Petrova SF, Khursan SL, Lin CW.. (2021) Glycyrrhetinic acid derivatives as Zika virus inhibitors: Synthesis and antiviral activity in vitro., 41 [PMID:34022526 ] [10.1016/j.bmc.2021.116204 ]