The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R,5S)-4-fluoro-1-(4-fluorophenylsulfonyl)-5-methyl-N-((5-(trifluoromethyl)-2-(2-(trifluoromethyl)pyrimidin-5-yl)pyridin-4-yl)methyl)pyrrolidine-2-carboxamide ID: ALA4865238
PubChem CID: 122490062
Product Number: G610531, Order Now?
Max Phase: Preclinical
Molecular Formula: C24H19F8N5O3S
Molecular Weight: 609.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1[C@H](F)C[C@@H](C(=O)NCc2cc(-c3cnc(C(F)(F)F)nc3)ncc2C(F)(F)F)N1S(=O)(=O)c1ccc(F)cc1
Standard InChI: InChI=1S/C24H19F8N5O3S/c1-12-18(26)7-20(37(12)41(39,40)16-4-2-15(25)3-5-16)21(38)34-8-13-6-19(33-11-17(13)23(27,28)29)14-9-35-22(36-10-14)24(30,31)32/h2-6,9-12,18,20H,7-8H2,1H3,(H,34,38)/t12-,18+,20-/m0/s1
Standard InChI Key: RGXNECXVRZKGGH-UOXRKKOCSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
5.4645 -10.7927 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0464 -11.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2594 -10.5797 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3914 -14.3091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5742 -14.3091 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9828 -15.0168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6966 -12.3322 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4861 -13.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2776 -12.9107 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4555 -14.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4543 -15.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1624 -15.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8721 -15.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8692 -14.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1606 -14.3171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7463 -15.9535 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5723 -13.4939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2310 -13.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9755 -12.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1583 -12.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9088 -13.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6754 -11.5820 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1331 -13.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0088 -13.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1805 -14.0641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6148 -12.7170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3926 -12.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9986 -12.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7762 -12.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3819 -12.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2104 -11.3246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4278 -11.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8255 -11.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1565 -12.3740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3268 -13.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1036 -13.4256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5360 -12.0748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7594 -11.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6613 -13.9263 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7432 -12.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4426 -11.9261 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
8 7 1 0
9 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
11 16 1 0
14 5 1 0
5 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
20 22 1 6
21 23 1 1
18 24 1 1
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
34 35 2 0
35 36 1 0
36 40 2 0
37 38 2 0
38 34 1 0
30 34 1 0
40 8 1 0
8 39 1 0
37 40 1 0
33 2 1 0
2 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 609.50Molecular Weight (Monoisotopic): 609.1081AlogP: 4.52#Rotatable Bonds: 6Polar Surface Area: 105.15Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.14CX Basic pKa: 2.48CX LogP: 4.02CX LogD: 4.02Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.41Np Likeness Score: -1.16
References 1. Villemure E, Terrett JA, Larouche-Gauthier R, Déry M, Chen H, Reese RM, Shields SD, Chen J, Magnuson S, Volgraf M.. (2021) A Retrospective Look at the Impact of Binding Site Environment on the Optimization of TRPA1 Antagonists., 12 (8.0): [PMID:34413952 ] [10.1021/acsmedchemlett.1c00305 ]