The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(4-((S)-1-carboxy-2-(4-hydroxyphenyl)ethylamino)-6-hydroxy-1,3,5-triazin-2-ylamino)succinic acid ID: ALA4865241
PubChem CID: 164624075
Max Phase: Preclinical
Molecular Formula: C16H17N5O8
Molecular Weight: 407.34
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C[C@H](Nc1nc(O)nc(N[C@@H](Cc2ccc(O)cc2)C(=O)O)n1)C(=O)O
Standard InChI: InChI=1S/C16H17N5O8/c22-8-3-1-7(2-4-8)5-9(12(25)26)17-14-19-15(21-16(29)20-14)18-10(13(27)28)6-11(23)24/h1-4,9-10,22H,5-6H2,(H,23,24)(H,25,26)(H,27,28)(H3,17,18,19,20,21,29)/t9-,10-/m0/s1
Standard InChI Key: XPBMFJONHHQPDN-UWVGGRQHSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
7.0235 -5.5291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0223 -6.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7371 -6.7693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4536 -6.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4507 -5.5254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7353 -5.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7329 -4.2913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1687 -6.7673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8825 -6.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5976 -6.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8812 -5.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5951 -5.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5938 -4.2902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3101 -5.5264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5989 -7.5901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3114 -6.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3075 -6.7684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5934 -6.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8786 -6.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5941 -5.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8799 -5.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1645 -6.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8780 -7.5922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8842 -4.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1708 -3.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4551 -4.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4571 -5.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1709 -5.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7404 -3.8787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 1 1
11 12 1 0
12 13 1 0
12 14 2 0
10 15 2 0
10 16 1 0
2 17 1 0
17 18 1 0
18 19 1 0
18 20 1 6
20 21 1 0
19 22 1 0
19 23 2 0
21 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 21 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.34Molecular Weight (Monoisotopic): 407.1077AlogP: -0.27#Rotatable Bonds: 10Polar Surface Area: 215.09Molecular Species: ACIDHBA: 10HBD: 7#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.67CX Basic pKa: 2.54CX LogP: 0.43CX LogD: -8.41Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.27Np Likeness Score: 0.02
References 1. Nagaoka Y, Parvatkar P, Hirai G, Ohkanda J.. (2021) Design, synthesis, and functional evaluation of triazine-based bivalent agents that simultaneously target the active site and hot spot of phosphatase Cdc25B., 48 [PMID:34273487 ] [10.1016/j.bmcl.2021.128265 ]