The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(((1-Acryloylpyrrolidin-3-yl)methyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4865278
PubChem CID: 164618797
Max Phase: Preclinical
Molecular Formula: C23H27N7O4
Molecular Weight: 465.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCC(CNc2nc(Nc3cc(OC)cc(OC)c3)c(C(N)=O)c3nccn23)C1
Standard InChI: InChI=1S/C23H27N7O4/c1-4-18(31)29-7-5-14(13-29)12-26-23-28-21(19(20(24)32)22-25-6-8-30(22)23)27-15-9-16(33-2)11-17(10-15)34-3/h4,6,8-11,14,27H,1,5,7,12-13H2,2-3H3,(H2,24,32)(H,26,28)
Standard InChI Key: KVAVHJDVINYPAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
27.2009 -14.4805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0259 -14.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4360 -15.1991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4407 -13.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2658 -13.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0378 -11.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0378 -12.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7498 -12.9668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4619 -12.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7498 -11.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4589 -11.7317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0726 -11.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7429 -10.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9255 -10.5144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1766 -12.9708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1769 -13.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8916 -14.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3221 -11.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3197 -10.4981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6089 -11.7377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3239 -12.9721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3251 -13.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6100 -14.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6108 -15.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3264 -15.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0426 -15.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0383 -14.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7591 -15.4359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7633 -16.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8967 -15.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8975 -16.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9816 -15.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7887 -15.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6485 -13.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 0
6 7 2 0
6 10 1 0
7 8 1 0
8 9 2 0
9 11 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
9 15 1 0
15 16 1 0
16 17 1 0
6 18 1 0
18 19 1 0
18 20 2 0
7 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
28 29 1 0
24 30 1 0
30 31 1 0
17 32 1 0
32 33 1 0
33 1 1 0
1 34 1 0
34 17 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.51Molecular Weight (Monoisotopic): 465.2125AlogP: 2.04#Rotatable Bonds: 9Polar Surface Area: 136.11Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.72CX Basic pKa: 5.13CX LogP: 1.66CX LogD: 1.65Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.99
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]