2-methoxy-4-(3-(4-(trifluoromethyl)benzylamino)butyl)phenol

ID: ALA4865307

PubChem CID: 66731659

Max Phase: Preclinical

Molecular Formula: C19H22F3NO2

Molecular Weight: 353.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CCC(C)NCc2ccc(C(F)(F)F)cc2)ccc1O

Standard InChI:  InChI=1S/C19H22F3NO2/c1-13(3-4-14-7-10-17(24)18(11-14)25-2)23-12-15-5-8-16(9-6-15)19(20,21)22/h5-11,13,23-24H,3-4,12H2,1-2H3

Standard InChI Key:  JWMMMNZRBWMHKZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    2.7267   -3.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7255   -3.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4336   -4.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1432   -3.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1404   -3.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4318   -2.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0189   -2.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0175   -4.3890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3101   -3.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8516   -4.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5587   -3.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2670   -4.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9741   -3.9760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6824   -4.3835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3895   -3.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2683   -5.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0950   -4.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8016   -3.9725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8007   -3.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0874   -2.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3838   -3.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5073   -2.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2162   -3.1503    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.5049   -1.9266    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.2096   -2.3278    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  2  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 12 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
M  END

Associated Targets(Human)

TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

N2a (708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.38Molecular Weight (Monoisotopic): 353.1603AlogP: 4.53#Rotatable Bonds: 7
Polar Surface Area: 41.49Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.37CX Basic pKa: 9.52CX LogP: 4.49CX LogD: 2.65
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -0.40

References

1. Rishton GM, Look GC, Ni ZJ, Zhang J, Wang Y, Huang Y, Wu X, Izzo NJ, LaBarbera KM, Limegrover CS, Rehak C, Yurko R, Catalano SM..  (2021)  Discovery of Investigational Drug CT1812, an Antagonist of the Sigma-2 Receptor Complex for Alzheimer's Disease.,  12  (9.0): [PMID:34531947] [10.1021/acsmedchemlett.1c00048]

Source