3-(5-(4-(4-(2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)pentyl)-1H-indole-5-carbonitrile

ID: ALA4865324

PubChem CID: 118190871

Max Phase: Preclinical

Molecular Formula: C29H31N5O

Molecular Weight: 465.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc2[nH]cc(CCCCCN3CCN(c4ccc(-n5ccccc5=O)cc4)CC3)c2c1

Standard InChI:  InChI=1S/C29H31N5O/c30-21-23-8-13-28-27(20-23)24(22-31-28)6-2-1-4-14-32-16-18-33(19-17-32)25-9-11-26(12-10-25)34-15-5-3-7-29(34)35/h3,5,7-13,15,20,22,31H,1-2,4,6,14,16-19H2

Standard InChI Key:  ZHICSWRSHPZEDK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    3.2723   -5.2998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0264   -4.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9416   -4.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1360   -3.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7237   -3.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8991   -3.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4868   -3.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8991   -4.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7237   -4.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4868   -2.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0745   -1.8300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5536   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3379   -3.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9498   -3.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7341   -3.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3503   -3.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1304   -3.2530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3026   -4.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0870   -4.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7031   -3.7628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5308   -2.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7465   -2.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4832   -4.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6555   -4.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4397   -5.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0559   -4.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8836   -3.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0993   -3.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4480   -4.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2365   -4.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4087   -5.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7926   -5.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0083   -5.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8360   -4.7824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2799   -3.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  3  0
  6 10  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  1  0
 29 35  2  0
 26 34  1  0
 20 23  1  0
 16 17  1  0
  3 12  1  0
M  END

Associated Targets(non-human)

Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.60Molecular Weight (Monoisotopic): 465.2529AlogP: 4.73#Rotatable Bonds: 8
Polar Surface Area: 68.06Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.48CX LogP: 5.16CX LogD: 4.05
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.25

References

1. Xu T, Xue Y, Lu J, Jin C..  (2021)  Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs.,  223  [PMID:34182358] [10.1016/j.ejmech.2021.113644]

Source