4-((trans-3-Hydroxycyclobutyl)amino)-6-(((4-(trifluoromethyl)-pyridin-3-yl)methyl)amino)nicotinonitrile

ID: ALA4865377

Max Phase: Preclinical

Molecular Formula: C17H16F3N5O

Molecular Weight: 363.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cnc(NCc2cnccc2C(F)(F)F)cc1N[C@H]1C[C@H](O)C1

Standard InChI:  InChI=1S/C17H16F3N5O/c18-17(19,20)14-1-2-22-7-11(14)9-24-16-5-15(10(6-21)8-23-16)25-12-3-13(26)4-12/h1-2,5,7-8,12-13,26H,3-4,9H2,(H2,23,24,25)/t12-,13-

Standard InChI Key:  ZLGMWRLHHPXYQS-JOCQHMNTSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    8.3287   -6.4880    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.1459   -6.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7373   -5.7803    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4196   -4.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7038   -5.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0059   -4.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2901   -5.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2764   -6.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9743   -6.5420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6901   -6.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1354   -4.5360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5606   -6.5162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5468   -7.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8173   -8.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8310   -7.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1331   -7.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4173   -7.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4036   -8.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1015   -8.9415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0197   -4.0910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7355   -3.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5211   -3.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7472   -3.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9616   -2.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4589   -2.7402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8613   -6.0939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  3  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 16  2  1  0
 13 15  1  0
 12 13  1  0
  8 12  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 21 24  1  0
 23 25  1  6
 21 20  1  1
  6 20  1  0
  2 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4865377

    ---

Associated Targets(Human)

PRKCQ Tchem Protein kinase C theta (3319 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 363.34Molecular Weight (Monoisotopic): 363.1307AlogP: 2.91#Rotatable Bonds: 5
Polar Surface Area: 93.86Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.54CX LogP: 0.91CX LogD: 0.86
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.76Np Likeness Score: -1.03

References

1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE..  (2021)  Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005.,  64  (16.0): [PMID:34355886] [10.1021/acs.jmedchem.1c00388]

Source