2-((1s,4s)-4-(4-(5-fluoro-4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl)-5,6-dihydropyridin-1(2H)-yl)cyclohexyl)acetic acid

ID: ALA4865444

PubChem CID: 90419551

Max Phase: Preclinical

Molecular Formula: C27H30FN3O3

Molecular Weight: 463.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CCC(N4CCC(CC(=O)O)CC4)CC3)cc12

Standard InChI:  InChI=1S/C27H30FN3O3/c1-34-25-7-4-19(28)15-22(25)21-8-11-29-27-23(21)16-24(30-27)18-2-5-20(6-3-18)31-12-9-17(10-13-31)14-26(32)33/h2,4,7-8,11,15-17,20H,3,5-6,9-10,12-14H2,1H3,(H,29,30)(H,32,33)

Standard InChI Key:  DSWFCORIUYZGGU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   26.6566   -1.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6554   -2.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3703   -2.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0867   -2.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0838   -1.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3684   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7967   -1.0978    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.9406   -2.7559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2265   -2.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3701   -3.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6557   -3.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6552   -4.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3701   -5.2290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0840   -3.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0914   -4.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8720   -5.0539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3472   -4.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8601   -3.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1721   -4.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5900   -5.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4114   -5.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8213   -4.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4037   -3.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5761   -3.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6463   -4.3706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0564   -5.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8778   -5.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2904   -4.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8755   -3.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0478   -3.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1154   -4.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5289   -5.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3539   -5.0768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1174   -5.7930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  2  8  1  0
  8  9  1  0
  3 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 15  1  0
 14 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
 19 20  1  0
 19 24  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H929 (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.55Molecular Weight (Monoisotopic): 463.2271AlogP: 5.50#Rotatable Bonds: 6
Polar Surface Area: 78.45Molecular Species: ZWITTERIONHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.43CX Basic pKa: 9.94CX LogP: 1.47CX LogD: 1.47
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.06

References

1. Tong Y, Florjancic AS, Clark RF, Lai C, Mastracchio A, Zhu GD, Smith ML, Kovar PJ, Shaw B, Albert DH, Qiu W, Longenecker KL, Liu X, Olson AM, Osterling DJ, Tahir SK, Phillips DC, Leverson JD, Souers AJ, Penning TD..  (2021)  Balancing Properties with Carboxylates: A Lead Optimization Campaign for Selective and Orally Active CDK9 Inhibitors.,  12  (7.0): [PMID:34267880] [10.1021/acsmedchemlett.1c00161]

Source