The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-(4-acetylpiperazin-1-yl)-2-methylpyrimidin-4-ylamino)-N-(2-chloro-4-methylthiophen-3-yl)thiazole-5-carboxamide ID: ALA4865466
PubChem CID: 153569045
Max Phase: Preclinical
Molecular Formula: C20H22ClN7O2S2
Molecular Weight: 492.03
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(c2cc(Nc3ncc(C(=O)Nc4c(C)csc4Cl)s3)nc(C)n2)CC1
Standard InChI: InChI=1S/C20H22ClN7O2S2/c1-11-10-31-18(21)17(11)26-19(30)14-9-22-20(32-14)25-15-8-16(24-12(2)23-15)28-6-4-27(5-7-28)13(3)29/h8-10H,4-7H2,1-3H3,(H,26,30)(H,22,23,24,25)
Standard InChI Key: RIJYZTZQMRSSEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.9668 -10.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9657 -11.4347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6737 -11.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3834 -11.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3806 -10.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6719 -10.2063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6741 -12.6560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9645 -13.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9623 -13.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6681 -14.2894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3777 -13.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3815 -13.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2590 -10.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6648 -15.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9555 -15.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0867 -10.2003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7960 -10.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8836 -11.4181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6836 -11.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0895 -10.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5404 -10.2705 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9019 -10.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3848 -11.4464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1972 -11.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2314 -10.0393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7453 -11.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4906 -11.6272 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.4020 -10.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6021 -10.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5783 -12.7624 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.2663 -9.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3709 -15.5180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 7 1 0
1 13 1 0
10 14 1 0
14 15 1 0
5 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
20 22 1 0
22 23 1 0
23 24 1 0
22 25 2 0
24 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 24 1 0
26 30 1 0
29 31 1 0
14 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.03Molecular Weight (Monoisotopic): 491.0965AlogP: 3.93#Rotatable Bonds: 5Polar Surface Area: 103.35Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.50CX Basic pKa: 6.47CX LogP: 3.76CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -2.20
References 1. (2020) Heterocyclic kinase inhibitors and uses thereof,