4-(6-amino-5-(1-oxo-1,2,3,4-tetrahydroisoquinolin-6-yl)pyridin-3-yl)-N-cyclopropyl-3-isopropoxy-N-methylbenzenesulfonamide

ID: ALA4865543

PubChem CID: 122588185

Max Phase: Preclinical

Molecular Formula: C27H30N4O4S

Molecular Weight: 506.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Oc1cc(S(=O)(=O)N(C)C2CC2)ccc1-c1cnc(N)c(-c2ccc3c(c2)CCNC3=O)c1

Standard InChI:  InChI=1S/C27H30N4O4S/c1-16(2)35-25-14-21(36(33,34)31(3)20-5-6-20)7-9-22(25)19-13-24(26(28)30-15-19)17-4-8-23-18(12-17)10-11-29-27(23)32/h4,7-9,12-16,20H,5-6,10-11H2,1-3H3,(H2,28,30)(H,29,32)

Standard InChI Key:  JOMSPKFTPGVHPJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    8.5124  -11.5316    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.8075  -11.9451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2229  -11.9353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2286  -12.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9277  -11.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5062  -12.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7430  -11.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3295  -10.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5062  -10.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7958  -10.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2238  -10.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5092   -9.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7999   -9.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2187   -9.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5057   -8.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0388   -4.5687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9287   -5.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6367   -5.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6393   -7.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9287   -6.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2165   -7.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5082   -6.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8037   -7.0326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8037   -7.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2165   -7.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5082   -5.8022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3371   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3452   -6.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0573   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7660   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7579   -5.7762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0412   -5.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9240   -9.0712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6341   -9.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3394   -9.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6388  -10.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9  1  1  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  3  5  1  0
  1  6  2  0
  7  5  1  0
  8  7  1  0
  5  8  1  0
 12 15  1  0
 12 13  2  0
 13 10  1  0
 10  9  2  0
 14 12  1  0
 14 11  2  0
 11  9  1  0
 32 16  2  0
 18 17  2  0
 27 18  1  0
 19 28  1  0
 20 19  2  0
 17 20  1  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 15 24  1  0
 25 15  2  0
 21 25  1  0
 22 26  1  0
 27 28  2  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 14 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4865543

    ---

Associated Targets(Human)

STK4 Tchem Serine/threonine-protein kinase MST1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.63Molecular Weight (Monoisotopic): 506.1988AlogP: 3.85#Rotatable Bonds: 7
Polar Surface Area: 114.62Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.84CX LogP: 3.06CX LogD: 3.05
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.50Np Likeness Score: -0.76

References

1.  (2020)  STK4 inhibitors for treatment of hematologic malignancies, 

Source