The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(((2S,3S)-1-(2-((1,3,4-oxadiazol-2-yl)methyl)benzyl)-2-phenylpiperidin-3-yl)oxy)-2-(3,5-dichlorophenyl)ethan-1-ol ID: ALA4865602
PubChem CID: 164619620
Max Phase: Preclinical
Molecular Formula: C29H29Cl2N3O3
Molecular Weight: 538.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@@H](O[C@H]1CCCN(Cc2ccccc2Cc2nnco2)[C@H]1c1ccccc1)c1cc(Cl)cc(Cl)c1
Standard InChI: InChI=1S/C29H29Cl2N3O3/c30-24-13-23(14-25(31)16-24)27(18-35)37-26-11-6-12-34(29(26)20-7-2-1-3-8-20)17-22-10-5-4-9-21(22)15-28-33-32-19-36-28/h1-5,7-10,13-14,16,19,26-27,29,35H,6,11-12,15,17-18H2/t26-,27+,29-/m0/s1
Standard InChI Key: WJEJYZMDGRXRFJ-GKRYNVPLSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.5060 -11.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5060 -12.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2113 -12.4188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9166 -12.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9166 -11.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2113 -10.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6255 -10.7907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6237 -12.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6193 -13.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3256 -13.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0349 -13.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0335 -12.4217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3266 -12.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6279 -9.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3368 -9.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0430 -9.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7515 -9.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7543 -8.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0428 -8.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3373 -8.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0423 -7.5285 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.4578 -9.9852 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.2113 -13.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9213 -9.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9237 -8.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5036 -13.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7972 -13.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0899 -13.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0895 -14.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8022 -14.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5065 -14.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7996 -12.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0931 -12.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0084 -11.1940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2095 -11.0218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7988 -11.7283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3439 -12.3371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 6
4 8 1 6
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
17 22 1 0
3 23 1 0
14 24 1 6
24 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.48Molecular Weight (Monoisotopic): 537.1586AlogP: 6.42#Rotatable Bonds: 9Polar Surface Area: 71.62Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.17CX LogP: 5.36CX LogD: 4.52Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.46
References 1. Hanisak J, Soriano A, Adam GC, Basso A, Bauman D, Bell D, Frank E, O'Donnell G, Tawa P, Verras A, Yu Y, Zhang L, Seganish WM.. (2021) Discovery of the First Non-cGMP Mimetic Small Molecule Activators of cGMP-Dependent Protein Kinase 1 α (PKG1α)., 12 (8.0): [PMID:34413956 ] [10.1021/acsmedchemlett.1c00264 ]