N-(4-chlorophenyl)-2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)acetamide

ID: ALA4865661

PubChem CID: 164621383

Max Phase: Preclinical

Molecular Formula: C22H15ClI2N4O4S2

Molecular Weight: 752.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccc(Cl)cc3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C22H15ClI2N4O4S2/c23-12-1-3-14(4-2-12)27-19(30)11-34-22-28-20-17(9-13(24)10-18(20)25)21(31)29(22)15-5-7-16(8-6-15)35(26,32)33/h1-10H,11H2,(H,27,30)(H2,26,32,33)

Standard InChI Key:  FLERGQAHNHUKEC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   19.7901  -16.7359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2028  -17.4458    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.6112  -16.7334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5306  -19.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5294  -19.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2375  -20.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2357  -18.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9443  -19.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9431  -19.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6532  -20.3048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3690  -19.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3702  -19.0703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6556  -18.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8227  -18.6635    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   15.2372  -21.1176    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   16.6556  -17.8372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0772  -18.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7842  -19.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4924  -18.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4949  -17.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7832  -17.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0779  -17.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0756  -20.3061    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9103  -17.8554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7844  -19.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4910  -20.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1999  -19.9035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4887  -21.1273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9064  -20.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8994  -21.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6051  -21.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3149  -21.1322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3146  -20.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6083  -19.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0220  -21.5418    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4865661

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 752.78Molecular Weight (Monoisotopic): 751.8313AlogP: 4.63#Rotatable Bonds: 6
Polar Surface Area: 124.15Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: CX LogP: 5.70CX LogD: 5.70
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.24

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source